
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-03-6 |
| Catalog No. | 2A-9024172 |
| Chinese Name | 1,2,4-三乙酰氧基苯 |
| Synonyms | MFCD00008700; EINECS 210-327-2; (3,4-diacetyloxyphenyl) acetate |
| Molecular Formula | (CH3CO2)3C6H3 |
| Molecular Weight | 252.22 |
| Purity | 97 |
| Density | 1.276g/cm3 |
| Boiling Point | 357ºC |
| Melting Point | 98-100 °C (lit.) |
| Appearance | solid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| EINECS | 210-327-2 |
| HTC | 2915390090 |
| PubChem ID | 24847542 |
| MDL Number | MFCD00008700 |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | 1S/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6H,1-3H3 |
| InChI Key | AESFGSJWSUZRGW-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/24172_1_613_03_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Nitrobenzyl chloride | 612-23-7 | 2A-9024157 |
| 2-Nitrocinnamic acid | 612-41-9 | 2A-9024160 |
| 3,3'-Dimethylbiphenyl | 612-75-9 | 2A-9024168 |
| 3,3'-Dimethylbenzidine dihydrochloride | 612-82-8 | 2A-9024169 |
| 3,3'-Dichlorobenzidine dihydrochloride | 612-83-9 | 2A-9024170 |
| 2-Methylanthracene | 613-12-7 | 2A-9024173 |
| 2-Aminoanthracene | 613-13-8 | 2A-9024174 |
| 1,2-Phenylenediacetonitrile | 613-23-0 | 2A-9024175 |
| N,N-Dibutylaniline | 613-29-6 | 2A-9024176 |
| 4-Methoxybiphenyl | 613-37-6 | 2A-9024178 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA