
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 611-00-7 |
| Catalog No. | 2A-9024120 |
| Chinese Name | 2,4-二溴苯甲酸 |
| Synonyms | 2,4-Dibromobenzoic acid; EINECS 210-245-7; QVR BE DE |
| Molecular Formula | C7H4Br2O2 |
| Molecular Weight | 279.914 |
| Purity | 98.00 |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 336.6±32.0 °C at 760 mmHg |
| Melting Point | 174ºC |
| Appearance | Petiole yellow powder or crystal |
| Storage Condition | room temperature |
| HTC | 2916399090 |
| SMILES | O=C(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C7H4Br2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChI Key | NAGGYODWMPFKJQ-UHFFFAOYSA-N |
| MSDS | msds/24120_1_611_00_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2,4-Dibromobenzoic acid Modification number: 5.3 |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Perchloromethylmercaptan | 594-42-3 | 2A-9023910 |
| 2,2,2-Trichloroacetamide | 594-65-0 | 2A-9023914 |
| 2,4-Dimethyl-3-pentanol | 600-36-2 | 2A-9023972 |
| 2,4-Dichloroquinazoline | 607-68-1 | 2A-9024051 |
| 2,4-Dimethylbenzenesulfonyl chloride | 609-60-9 | 2A-9024087 |
| 2,4-Dihydroxycinnamic acid | 614-86-8 | 2A-9024210 |
| 2,4-Diaminoanisole | 615-05-4 | 2A-9024214 |
| 2,4-Dibromoaniline | 615-57-6 | 2A-9024231 |
| Ethyl 2,4-dioxovalerate | 615-79-2 | 2A-9024239 |
| 2,4-Dihydroxythiazole | 625-85-4 | 2A-9024488 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA