
CAS Number610-14-0
Synonyms2-Nitrobenzoylchloride; ORTHO-NITROBENZOYLCHLORIDE; o-nitrobenzoic acid chloride; 2-Nitrobenzoyl chloride; 2-Nitrobenzoic acid chloride; EINECS 210-206-4; 2-nitro-1-benzenecarbonyl chloride; O-NITROBENZOYL CHLORIDE; Benzoyl chloride,2-nitro; nitrobenzoyl chloride; MFCD00007131; o-nitro-benzoylchlorid; 2-nitro-benzoylchlorid; Benzoyl chloride,o-nitro; mononitrobenzoyl chloride
Molecular FormulaO2NC6H4COCl
Molecular Weight185.56
Purity97%
Density1.5±0.1 g/cm3
Boiling Point148-149 °C/9 mmHg (lit.)
Melting Point17-20 °C (lit.)
Appearanceliquid
EINECS210-206-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-14-0 |
| Catalog No. | 2A-9024100 |
| Chinese Name | 2-硝基苯甲酰氯 |
| Synonyms | 2-Nitrobenzoylchloride; ORTHO-NITROBENZOYLCHLORIDE; o-nitrobenzoic acid chloride; 2-Nitrobenzoyl chloride; 2-Nitrobenzoic acid chloride; EINECS 210-206-4; 2-nitro-1-benzenecarbonyl chloride; O-NITROBENZOYL CHLORIDE; Benzoyl chloride,2-nitro; nitrobenzoyl chloride; MFCD00007131; o-nitro-benzoylchlorid; 2-nitro-benzoylchlorid; Benzoyl chloride,o-nitro; mononitrobenzoyl chloride |
| Molecular Formula | O2NC6H4COCl |
| Molecular Weight | 185.56 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 148-149 °C/9 mmHg (lit.) |
| Melting Point | 17-20 °C (lit.) |
| Appearance | liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | III |
| EINECS | 210-206-4 |
| HTC | 2916399090 |
| PubChem ID | 24859338 |
| MDL Number | MFCD00007131 |
| SMILES | [O-][N+](=O)c1ccccc1C(Cl)=O |
| InChI | 1S/C7H4ClNO3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H |
| InChI Key | BWWHTIHDQBHTHP-UHFFFAOYSA-N |
| Beilstein/REAXYS | 777991 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/24100_1_610_14_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-3,5-dibromobenzoic acid | 609-85-8 | 2A-9024094 |
| 2,6-Dinitro-p-cresol | 609-93-8 | 2A-9024096 |
| 3,5-Dinitrosalicylic acid | 609-99-4 | 2A-9024097 |
| 2,3,4-Trihydroxybenzoic acid | 610-02-6 | 2A-9024098 |
| cis-Hexahydrophthalic acid | 610-09-3 | 2A-9024099 |
| Dimethyl 4-nitrophthalate | 610-22-0 | 2A-9024101 |
| 4-Nitrophthalic acid | 610-27-5 | 2A-9024102 |
| Nitroterephthalic acid | 610-29-7 | 2A-9024103 |
| 4-Hydroxyphthalic acid | 610-35-5 | 2A-9024104 |
| 4-Amino-2-nitrobenzoic acid | 610-36-6 | 2A-9024105 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA