
CAS Number6358-09-4
Synonyms2-amino-4-nitro-6-chlorophenol; MFCD00035767; Phenol,2-amino-6-chloro-4-nitro; 2-amino-6-chloro-4-nitro-phenol; EINECS 228-762-1; 1-hydroxy-2-chloro-6-amino-4-nitrobenzene; 6-Chloro-4-nitro-2-aminophenol; 2-chloro-4-nitro-6-aminophenol; 2-Amino-6-chlor-4-nitro-phenol; 5-amino-3-chloro-4-hydroxynitrobenzene
Molecular FormulaC6H5O1N1Cl1Br1
Molecular Weight222.47
Purity98%
Density1.655 g/cm3
Boiling Point358.7ºC at 760 mmHg
Melting Point158-162.5℃
EINECS228-762-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6358-09-4 |
| Catalog No. | 2A-9002339 |
| Chinese Name | 2-氨基-6-氯-4-硝基苯酚 |
| Synonyms | 2-amino-4-nitro-6-chlorophenol; MFCD00035767; Phenol,2-amino-6-chloro-4-nitro; 2-amino-6-chloro-4-nitro-phenol; EINECS 228-762-1; 1-hydroxy-2-chloro-6-amino-4-nitrobenzene; 6-Chloro-4-nitro-2-aminophenol; 2-chloro-4-nitro-6-aminophenol; 2-Amino-6-chlor-4-nitro-phenol; 5-amino-3-chloro-4-hydroxynitrobenzene |
| Molecular Formula | C6H5O1N1Cl1Br1 |
| Molecular Weight | 222.47 |
| Purity | 98 |
| Density | 1.655 g/cm3 |
| Boiling Point | 358.7ºC at 760 mmHg |
| Melting Point | 158-162.5℃ |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| EINECS | 228-762-1 |
| HTC | 2922299090 |
| MDL Number | MFCD16742724 |
| SMILES | Nc1cc([N+](=O)[O-])cc(Cl)c1O |
| InChI | InChI=1S/C6H5ClN2O3.ClH/c7-4-1-3(9(11)12)2-5(8)6(4)10;/h1-2,10H,8H2;1H |
| InChI Key | TWLMSPNQBKSXOP-UHFFFAOYSA-N |
| MSDS | msds/2339_1_6358_09_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-4-fluorobenzoic acid | 446-32-2 | 2A-9002321 |
| 2-Amino-4'-fluorobenzophenone | 3800-06-4 | 2A-9002322 |
| 2-Amino-4-fluorophenol | 399-97-3 | 2A-9002323 |
| 2-Amino-4-hydroxyethylaminoanisole sulfate | 83763-48-8 | 2A-9002329 |
| 2-Amino-4-iminoheptafluoropent-2-ene | 77953-70-9 | 2A-9002332 |
| 2-Amino-4-nitrobenzoic acid | 619-17-0 | 2A-9002340 |
| 2-Amino-4-nitrophenol-6-sulfonic acid | 96-67-3 | 2A-9002341 |
| 2-Amino-5,5-dimethyl-5,6-dihydro-4H-benzothiazol-7-one | 1629-95-4 | 2A-9002347 |
| 2-Amino-5-{4-[2-(5-ethyl-2-pyridyl)ethoxy]benzyl}-4(5H)-thiazolone | 105355-26-8 | 2A-9002350 |
| 2-Amino-5-acetylaminobenzotrifluoride | 1579-89-1 | 2A-9002351 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA