
CAS Number2894-51-1
SynonymsMFCD00025193; EINECS 220-770-3; (2-Aminophenyl)(4-chlorophenyl)methanone; 2-Amino-4'-Chlorobenzophenone
Molecular FormulaC13H10O1N1Cl1
Molecular Weight231.68
Purity96%
Density1.3±0.1 g/cm3
Boiling Point419.8±30.0 °C at 760 mmHg
Melting Point103°C
EINECS220-770-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2894-51-1 |
| Catalog No. | 2A-9002315 |
| Chinese Name | 2-氨基-4'-氯二苯甲酮 |
| Synonyms | MFCD00025193; EINECS 220-770-3; (2-Aminophenyl)(4-chlorophenyl)methanone; 2-Amino-4'-Chlorobenzophenone |
| Molecular Formula | C13H10O1N1Cl1 |
| Molecular Weight | 231.68 |
| Purity | 96 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 419.8±30.0 °C at 760 mmHg |
| Melting Point | 103°C |
| Storage Condition | Sealed in a cool, dry environment |
| EINECS | 220-770-3 |
| HTC | 2922399090 |
| MDL Number | MFCD00025193 |
| SMILES | Nc1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClNO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H,15H2 |
| InChI Key | APHLSUBLNQBFTM-UHFFFAOYSA-N |
| MSDS | msds/2315_1_2894_51_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-4'-bromobenzophenone | 1140-17-6 | 2A-9002308 |
| 2-Amino-4-chloro-6-nitrophenol | 6358-08-3 | 2A-9002310 |
| 2-Amino-4'-chloroacetophenone hydrochloride | 5467-71-0 | 2A-9002312 |
| 2-Amino-4-chlorobenzenethiol | 1004-00-8 | 2A-9002313 |
| 2-Amino-4-chlorobenzonitrile | 38487-86-4 | 2A-9002314 |
| 2-Amino-4'-chlorodiphenyl sulfide | 37750-29-1 | 2A-9002316 |
| 2-Amino-4'-fluoroacetophenone hydrochloride | 456-00-8 | 2A-9002320 |
| 2-Amino-4-fluorobenzoic acid | 446-32-2 | 2A-9002321 |
| 2-Amino-4'-fluorobenzophenone | 3800-06-4 | 2A-9002322 |
| 2-Amino-4-fluorophenol | 399-97-3 | 2A-9002323 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA