CAS Number570-08-1
SynonymsButanoic acid, (ethoxycarbonyl)-3-oxo-, ethyl ester; Acetonedicarboxylic acid diethyl ester; Acetonedicarboxylic acid, diethyl ester; Propanedioic acid, 2-acetyl-, diethyl ester; Ethyl acetomalonate; Ethyl acetonedicarboxylate; Diethyl acetonedicarboxylate (VAN); diethyl 2-acetylpropanedioate; Malonic acid, acetyl-, diethyl ester; Diethyl acetylmalonate; Propanedioic acid, acetyl-, diethyl ester; Diethyl acetonedicarboxylate; MFCD00026876
Molecular FormulaC9H14O5
Molecular Weight202.204
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point232.0±0.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 570-08-1 |
| Catalog No. | 2A-9022969 |
| Chinese Name | 瑞吡司特中间体 |
| Synonyms | Butanoic acid, (ethoxycarbonyl)-3-oxo-, ethyl ester; Acetonedicarboxylic acid diethyl ester; Acetonedicarboxylic acid, diethyl ester; Propanedioic acid, 2-acetyl-, diethyl ester; Ethyl acetomalonate; Ethyl acetonedicarboxylate; Diethyl acetonedicarboxylate (VAN); diethyl 2-acetylpropanedioate; Malonic acid, acetyl-, diethyl ester; Diethyl acetylmalonate; Propanedioic acid, acetyl-, diethyl ester; Diethyl acetonedicarboxylate; MFCD00026876 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.204 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 232.0±0.0 °C at 760 mmHg |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2918300090 |
| SMILES | CCOC(=O)C(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C9H14O5/c1-4-13-8(11)7(6(3)10)9(12)14-5-2/h7H,4-5H2,1-3H3 |
| InChI Key | SQAUUQRBOCJRCW-UHFFFAOYSA-N |
| MSDS | msds/22969_1_570_08_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxy-6-methylbenzoic acid | 567-61-3 | 2A-9022958 |
| Acid Mordant Orange 14 | 568-93-4 | 2A-9022962 |
| Aluminon | 569-58-4 | 2A-9022964 |
| Meclozine | 569-65-3 | 2A-9022967 |
| 2,4,6-Trimethoxybenzoic acid | 570-02-5 | 2A-9022968 |
| 2-Methyl-6-nitroaniline | 570-24-1 | 2A-9022972 |
| Withanolide E | 38254-15-8 | 2A-9022974 |
| Ethyl 2-(ethoxymethylene)-4,4,4-trifluoroacetoacetate | 571-55-1 | 2A-9022975 |
| 1,4-Dihydroxynaphthalene | 571-60-8 | 2A-9022976 |
| 9-Bromophenanthrene | 573-17-1 | 2A-9022983 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS