
CAS Number569-51-7
SynonymsHEMIMELLITIC ACID; EINECS 209-317-0; benzenetricarboxylic acid; benzene-1,2,3-tricarboxylic acid; MFCD00002468; 1,2,3-Benzenetricarboxylic acid; benzene tricarboxylic acid
Molecular FormulaC6H3(CO2H)3·xH2O
Molecular Weight210.14 (anhydrous basis)
Purity98%
Density1.7±0.1 g/cm3
Boiling Point491.3±40.0 °C at 760 mmHg
Melting Point190-192 °C (dec.) (lit.)
Appearancecrystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 569-51-7 |
| Catalog No. | 2A-9022963 |
| Chinese Name | 1,2,3-苯三甲酸 |
| Synonyms | HEMIMELLITIC ACID; EINECS 209-317-0; benzenetricarboxylic acid; benzene-1,2,3-tricarboxylic acid; MFCD00002468; 1,2,3-Benzenetricarboxylic acid; benzene tricarboxylic acid |
| Molecular Formula | C6H3(CO2H)3·xH2O |
| Molecular Weight | 210.14 (anhydrous basis) |
| Purity | 98 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 491.3±40.0 °C at 760 mmHg |
| Melting Point | 190-192 °C (dec.) (lit.) |
| Appearance | crystals |
| Storage Condition | This product should be kept sealed. |
| HTC | 2917399090 |
| PubChem ID | 24891760 |
| MDL Number | MFCD00149096 |
| SMILES | O.OC(=O)c1cccc(C(O)=O)c1C(O)=O |
| InChI | 1S/C9H6O6.H2O/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;/h1-3H,(H,10,11)(H,12,13)(H,14,15);1H2 |
| InChI Key | DYDNZUYNRZENMU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/22963_1_569_51_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified Triphenyltricarboxylic acid hydrate Modification number: 6 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1,2,4-Benzenetricarboxylic acid | 528-44-9 | 2A-9022530 |
| 2-Methylbenzaldehyde | 529-20-4 | 2A-9022540 |
| 1-Methylpyridinium-3-carboxylate | 535-83-1 | 2A-9022671 |
| 1,3-Acetonedicarboxylic acid | 542-05-2 | 2A-9022759 |
| Semicarbazide hydrochloride | 563-41-7 | 2A-9022925 |
| Benzophenone oxime | 574-66-3 | 2A-9022993 |
| 3-(3-Trifluoromethylphenyl)propionic acid | 585-50-2 | 2A-9023092 |
| Isovaleraldehyde | 590-86-3 | 2A-9023161 |
| Bromomethyl acetate | 590-97-6 | 2A-9023165 |
| 2,6-Dinitrobenzaldehyde | 606-31-5 | 2A-9024037 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA