
CAS Number344-80-9
Synonyms2-Amino-2'-fluoro-5-nitrobenzophenone; 2-amino-5-nitro-2'-fluoro-benzophenone; (2-amino-5-nitrophenyl)-(2-fluorophenyl)methanone; Benzophenone, 2-amino-2'-fluoro-5-nitro; EINECS 206-454-8; MFCD00970341; (2-Amino-5-nitrophenyl)(2-fluorophenyl)methanone; 2-Amino-2'-fluoro-5-nitro benzophenone
Molecular FormulaH2NC6H3(NO2)C(O)C6H5
Molecular Weight242.23
Purity≥98%
Density1.4±0.1 g/cm3
Boiling Point485.6±45.0 °C at 760 mmHg
Melting Point166-168 °C (lit.)
Appearancepowder
EINECS217-207-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 344-80-9 |
| Catalog No. | 2A-9002235 |
| Chinese Name | 2-氨基-5-硝基-2''-氟二苯甲酮 |
| Synonyms | 2-Amino-2'-fluoro-5-nitrobenzophenone; 2-amino-5-nitro-2'-fluoro-benzophenone; (2-amino-5-nitrophenyl)-(2-fluorophenyl)methanone; Benzophenone, 2-amino-2'-fluoro-5-nitro; EINECS 206-454-8; MFCD00970341; (2-Amino-5-nitrophenyl)(2-fluorophenyl)methanone; 2-Amino-2'-fluoro-5-nitro benzophenone |
| Molecular Formula | H2NC6H3(NO2)C(O)C6H5 |
| Molecular Weight | 242.23 |
| Purity | ≥98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 485.6±45.0 °C at 760 mmHg |
| Melting Point | 166-168 °C (lit.) |
| Appearance | powder |
| Storage Condition | Refrigerator |
| EINECS | 217-207-9 |
| HTC | 2922399090 |
| PubChem ID | 24852702 |
| MDL Number | MFCD00007364 |
| SMILES | Nc1ccc(cc1C(=O)c2ccccc2)[N+]([O-])=O |
| InChI | 1S/C13H10N2O3/c14-12-7-6-10(15(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,14H2 |
| InChI Key | PZPZDEIASIKHPY-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/2235_1_344_80_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-2',4'-dichloroacetophenone | 313553-17-2 | 2A-9002230 |
| 2-Amino-2',4'-difluoroacetophenone | 643029-92-9 | 2A-9002231 |
| 2-Amino-2',5'-dichlorobenzophenone | 21723-84-2 | 2A-9002232 |
| 2-Amino-2',5-dichlorobenzophenone | 2958-36-3 | 2A-9002233 |
| 2-Amino-2'-chloro-5-nitrobenzophenone | 2011-66-7 | 2A-9002234 |
| 2-Amino-2'-methyldiphenyl ether | 3840-18-4 | 2A-9002236 |
| 2-Amino-2-methylpropane nitrile | 19355-69-2 | 2A-9002237 |
| 2-Amino-3-(2-oxo-1,2-dihydroquinolin-4-yl)propionic acid hydrochloride | 4876-14-6 | 2A-9002240 |
| 2-Amino-3,4,5,6-tetrafluorobenzoic acid | 1765-42-0 | 2A-9002242 |
| 2-Amino-3,5-dibromo-4,6-dimethylpyridin | 2A-102243 | 2A-9002243 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA