
CAS Number501-92-8
SynonymsPhenol,4-(2-propenyl); 4-prop-2-enylphenol; 4-(prop-2-enyl)phenol; 1-allyl-4-hydroxybenzene; Phenol,p-allyl; 4-(2-propenyl)phenol; p-Hydroxyallylbenzene; Chavicol; p-Allylphenol; 4-allyl phenol
Molecular FormulaC9H10O1
Molecular Weight134.18
Purity98.00%
Density1.014g/cm3
Boiling Point238ºC at 760mmHg
Melting Point15.8°
AppearanceColorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 501-92-8 |
| Catalog No. | 2A-9022320 |
| Chinese Name | 4-烯丙基苯酚 |
| Synonyms | Phenol,4-(2-propenyl); 4-prop-2-enylphenol; 4-(prop-2-enyl)phenol; 1-allyl-4-hydroxybenzene; Phenol,p-allyl; 4-(2-propenyl)phenol; p-Hydroxyallylbenzene; Chavicol; p-Allylphenol; 4-allyl phenol |
| Molecular Formula | C9H10O1 |
| Molecular Weight | 134.18 |
| Purity | 98.00 |
| Density | 1.014g/cm3 |
| Boiling Point | 238ºC at 760mmHg |
| Melting Point | 15.8° |
| Appearance | Colorless to yellow liquid |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2907199090 |
| MDL Number | MFCD24711753 |
| SMILES | C=CCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O/c1-2-3-8-4-6-9(10)7-5-8/h2,4-7,10H,1,3H2 |
| InChI Key | RGIBXDHONMXTLI-UHFFFAOYSA-N |
| MSDS | msds/22320_1_501_92_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Heptylresorcinol | 500-67-4 | 2A-9022311 |
| 3,5-Dimethoxyphenol | 500-99-2 | 2A-9022312 |
| Cidofovir hydrate | 149394-66-1 | 2A-9022315 |
| Benzyl chloroformate | 501-53-1 | 2A-9022317 |
| Diphenylacetylene | 501-65-5 | 2A-9022318 |
| 4-Hydroxyphenethyl alcohol | 501-94-0 | 2A-9022321 |
| 4-Hydroxycinnamic acid | 501-98-4 | 2A-9022323 |
| 6-Hexanolactone | 502-44-3 | 2A-9022326 |
| Cyclooctanone | 502-49-8 | 2A-9022327 |
| 5-Nonanone | 502-56-7 | 2A-9022328 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA