
CAS Number458-46-8
Synonyms3-(3-Fluorophenyl)acrylic acid; 3-(3-Fluorophenyl)propanoic acid; MFCD01310821; 3-FluorocinnaMic Acid; 3-(3-Fluorophenyl)propionic acid; EINECS 207-281-0
Molecular FormulaC9H6BrFO2
Molecular Weight245.049
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point270.6±15.0 °C at 760 mmHg
Melting Point43-47 °C(lit.)
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 458-46-8 |
| Catalog No. | 2A-9022014 |
| Chinese Name | 3-氟肉桂酸 |
| Synonyms | 3-(3-Fluorophenyl)acrylic acid; 3-(3-Fluorophenyl)propanoic acid; MFCD01310821; 3-FluorocinnaMic Acid; 3-(3-Fluorophenyl)propionic acid; EINECS 207-281-0 |
| Molecular Formula | C9H6BrFO2 |
| Molecular Weight | 245.049 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 270.6±15.0 °C at 760 mmHg |
| Melting Point | 43-47 °C(lit.) |
| Appearance | white powder |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| HTC | 2916399090 |
| MDL Number | MFCD00143095 |
| SMILES | O=C(O)C=Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H7FO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H,11,12)/b5-4+ |
| InChI Key | RTSIUKMGSDOSTI-UHFFFAOYSA-N |
| MSDS | msds/22014_1_458_46_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Fluorocinnamic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluorobenzamidine hydrochloride | 456-14-4 | 2A-9021994 |
| 4-Nitrobenzenediazonium tetrafluoroborate | 456-27-9 | 2A-9021997 |
| 4,4'-Difluorodiphenylmethane | 457-68-1 | 2A-9022009 |
| 3-Fluorophenetole | 458-03-7 | 2A-9022010 |
| 3-Fluoro-4-hydroxyphenylacetic acid | 458-09-3 | 2A-9022011 |
| 4-Bromo-3-fluoroanisole | 458-50-4 | 2A-9022015 |
| 2-Fluoro-4-methoxyaniline | 458-52-6 | 2A-9022016 |
| 1-(4-Fluorophenyl)propan-2-amine hydrochloride | 459-01-8 | 2A-9022017 |
| 1-(4-Fluorophenyl)propane-2-amine | 459-02-9 | 2A-9022018 |
| 4-Methoxybenzenediazonium tetrafluoroborate | 459-64-3 | 2A-9022029 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA