
CAS Number375-22-4
SynonymsPerfluorobutanoic acid; MFCD00004171; perfluorobutyric acid; 2,2,3,3,4,4,4-heptafluorobutanoic acid; EINECS 206-786-3; Heptafluorobutyric acid; Heptafluorobutanoic acid
Molecular FormulaCF3CF2CF2COOH
Molecular Weight214.04
Purity98%
Density1.7±0.1 g/cm3
Boiling Point120 °C/755 mmHg (lit.)
Melting Point-17.5 °C
Appearanceliquid
EINECS206-786-3
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 375-22-4 |
| Catalog No. | 2A-9021596 |
| Chinese Name | 七氟丁酸 |
| Synonyms | Perfluorobutanoic acid; MFCD00004171; perfluorobutyric acid; 2,2,3,3,4,4,4-heptafluorobutanoic acid; EINECS 206-786-3; Heptafluorobutyric acid; Heptafluorobutanoic acid |
| Molecular Formula | CF3CF2CF2COOH |
| Molecular Weight | 214.04 |
| Purity | 98 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 120 °C/755 mmHg (lit.) |
| Melting Point | -17.5 °C |
| Appearance | liquid |
| Water Solubility | miscible |
| Storage Condition | Store in a cool, dry place filled with argon gas. |
| Packaging | II |
| EINECS | 206-786-3 |
| HTC | 2915900090 |
| PubChem ID | 24850063 |
| MDL Number | MFCD00004171 |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C4HF7O2/c5-2(6,1(12)13)3(7,8)4(9,10)11/h(H,12,13) |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1426882 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/21596_1_375_22_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetramethylammonium fluoride | 373-68-2 | 2A-9021591 |
| 2,2,2-Trifluoroethylamine hydrochloride | 373-88-6 | 2A-9021592 |
| 2,2-Difluoropropionic acid | 373-96-6 | 2A-9021593 |
| 1,1,1-Trifluoropropan-2-ol | 374-01-6 | 2A-9021594 |
| Heptafluorobutyryl chloride | 375-16-6 | 2A-9021595 |
| Perfluoroheptanoic acid | 375-85-9 | 2A-9021600 |
| 1H-Perfluorodecane | 375-97-3 | 2A-9021601 |
| 2-(N-Ethylperfluorooctanesulfonamido)ethyl methacrylate | 376-14-7 | 2A-9021602 |
| 1H,1H,9H-Hexadecafluoro-1-nonanol | 376-18-1 | 2A-9021603 |
| Methyl pentafluoropropionate | 378-75-6 | 2A-9021607 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA