
CAS Number369-32-4
SynonymsFR B1 DV1; 1-(4-fluoro-3-methyl-phenyl)-ethanone; methyl 4-fluoro-3-methylphenyl ketone; 1-(4-Fluoro-3-methylphenyl)ethanone; 1-acetyl-4-fluoro-3-methylbenzene
Molecular FormulaC9H9O1F1
Molecular Weight152.17
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point224.0±20.0 °C at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 369-32-4 |
| Catalog No. | 2A-9021558 |
| Chinese Name | 4-氟-3-甲基苯乙酮 |
| Synonyms | FR B1 DV1; 1-(4-fluoro-3-methyl-phenyl)-ethanone; methyl 4-fluoro-3-methylphenyl ketone; 1-(4-Fluoro-3-methylphenyl)ethanone; 1-acetyl-4-fluoro-3-methylbenzene |
| Molecular Formula | C9H9O1F1 |
| Molecular Weight | 152.17 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 224.0±20.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Room Temperature |
| HTC | 2914700090 |
| MDL Number | MFCD04972879 |
| SMILES | CC(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C9H9FO/c1-6-5-8(7(2)11)3-4-9(6)10/h3-5H,1-2H3 |
| InChI Key | SMSVMBMJEYTUOZ-UHFFFAOYSA-N |
| MSDS | msds/21558_1_369_32_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-Diaminofluorobenzene | 367-31-7 | 2A-9021539 |
| Sodium thioglycolate | 367-51-1 | 2A-9021542 |
| 4-Fluoro-3-nitrobenzotrifluoride | 367-86-2 | 2A-9021546 |
| Triethyloxonium tetrafluoroborate | 368-39-8 | 2A-9021548 |
| Methyl 3,4-difluorobenzoate | 369-25-5 | 2A-9021557 |
| 2-Fluoro-4-nitroaniline | 369-35-7 | 2A-9021561 |
| 2-Amino-4'-fluoroacetophenone | 369-43-7 | 2A-9021563 |
| 4-[2-(Methylamino)ethyl]phenol | 370-98-9 | 2A-9021565 |
| Ethyl 4,4,4-trifluorobutyrate | 371-26-6 | 2A-9021568 |
| 4-Fluoroaniline | 371-40-4 | 2A-9021569 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA