
CAS Number344-00-3
Synonymsethyl 2-methyl-4,4,4-trifluoroacetoacetate; ethyl 2-methyltrifluoroacetoacetate; 4,4,4-trifluoro-2-methyl-3-oxo-butyric acid ethyl ester; MFCD00190635; Ethyl 4,4,4-trifluoro-2-methyl-3-oxobutanoate; ethyl-3-keto-2-methyl-4,4,4-trifluorobutanoate; ZLB0114; ethyl 3-keto-2-methyl-4,4,4-trifluorobutyrate
Molecular FormulaC7H9O3F3
Molecular Weight198.14
Purity98.00%
Density1,2 g/cm3
Boiling Point144 °C
Appearancecolorless liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 344-00-3 |
| Catalog No. | 2A-9021376 |
| Chinese Name | 2-甲基-4,4,4-三氟乙酰乙酸乙酯 |
| Synonyms | ethyl 2-methyl-4,4,4-trifluoroacetoacetate; ethyl 2-methyltrifluoroacetoacetate; 4,4,4-trifluoro-2-methyl-3-oxo-butyric acid ethyl ester; MFCD00190635; Ethyl 4,4,4-trifluoro-2-methyl-3-oxobutanoate; ethyl-3-keto-2-methyl-4,4,4-trifluorobutanoate; ZLB0114; ethyl 3-keto-2-methyl-4,4,4-trifluorobutyrate |
| Molecular Formula | C7H9O3F3 |
| Molecular Weight | 198.14 |
| Purity | 98.00 |
| Density | 1,2 g/cm3 |
| Boiling Point | 144 °C |
| Appearance | colorless liquid |
| Storage Condition | Room Temperature |
| Packaging | III |
| HTC | 2918300090 |
| MDL Number | MFCD00190635 |
| SMILES | CCOC(=O)C(C)C(=O)C(F)(F)F |
| InChI Key | YLRGPBKEZVHOAW-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/21376_1_344_00_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isoflupredone | 338-95-4 | 2A-9021363 |
| Isoflupredone acetate | 338-98-7 | 2A-9021364 |
| 1-Fluoro-4-nitronaphthalene | 341-92-4 | 2A-9021369 |
| 5-Fluorogramine | 343-90-8 | 2A-9021373 |
| 6-Fluorogramine | 343-93-1 | 2A-9021374 |
| 2-Bromo-5-chlorobenzotrifluoride | 344-65-0 | 2A-9021385 |
| 4-Fluorosalicylic acid | 345-29-9 | 2A-9021391 |
| 2-Fluorobenzyl chloride | 345-35-7 | 2A-9021393 |
| 4-Fluorobenzophenone | 345-83-5 | 2A-9021394 |
| 4'-Fluoro-2-phenylacetophenone | 347-84-2 | 2A-9021402 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA