
CAS Number335-64-8
SynonymsPerfluorooctanoyl chloride; Pentadecafluorooctanoyl chloride; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-octanoyl chloride; Octanoyl chloride,pentadecafluoro; perfluorooctanyl chloride; pentafluorooctanol chloride; pentadecafluorooctanoic acid chloride; perfluorooctanoic acid chloride; MFCD00013654; EINECS 206-394-2
Molecular FormulaCF3(CF2)6COCl
Molecular Weight432.51
Purity97%
Density1.744 g/mL at 25 °C(lit.)
Boiling Point129-130 °C/744 mmHg (lit.)
Appearancecolorless liquid
EINECS206-394-2
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 335-64-8 |
| Catalog No. | 2A-9021352 |
| Chinese Name | 全氟辛酰氯 |
| Synonyms | Perfluorooctanoyl chloride; Pentadecafluorooctanoyl chloride; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-octanoyl chloride; Octanoyl chloride,pentadecafluoro; perfluorooctanyl chloride; pentafluorooctanol chloride; pentadecafluorooctanoic acid chloride; perfluorooctanoic acid chloride; MFCD00013654; EINECS 206-394-2 |
| Molecular Formula | CF3(CF2)6COCl |
| Molecular Weight | 432.51 |
| Purity | 97 |
| Density | 1.744 g/mL at 25 °C(lit.) |
| Boiling Point | 129-130 °C/744 mmHg (lit.) |
| Appearance | colorless liquid |
| Storage Condition | Room Temperature |
| Packaging | II |
| EINECS | 206-394-2 |
| HTC | 29159080 |
| PubChem ID | 24857497 |
| MDL Number | MFCD00013654 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(Cl)=O |
| InChI | 1S/C8ClF15O/c9-1(25)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 |
| InChI Key | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352200 |
| Hazard Symbols | 8 |
| MSDS | msds/21352_1_335_64_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Potassium thiocyanate | 333-20-0 | 2A-9021343 |
| Methyl trifluoromethanesulfonate | 333-27-7 | 2A-9021344 |
| 1,4-Diaminobutane dihydrochloride | 333-93-7 | 2A-9021346 |
| Perfluorohexyl bromide | 335-56-8 | 2A-9021350 |
| Perfluoroheptane | 335-57-9 | 2A-9021351 |
| 1H-Perfluorooctane | 335-65-9 | 2A-9021353 |
| 3-[(Perfluorooxooctyl)amino]Propyltrimethylammonium iodide | 335-90-0 | 2A-9021356 |
| 1H,1H,7H-Dodecafluoroheptanol | 335-99-9 | 2A-9021357 |
| Flugestone | 337-03-1 | 2A-9021359 |
| Isoflupredone | 338-95-4 | 2A-9021363 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA