
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59189-51-4 |
| Catalog No. | 2A-9002109 |
| Chinese Name | 2,6-二氟二苯甲酮 |
| Synonyms | (2,6-difluorophenyl)-phenylmethanone; EINECS 261-650-0; MFCD00009895 |
| Molecular Formula | C13H8F2O |
| Molecular Weight | 218.19900 |
| Purity | 98 |
| Density | 1.244 g/mL at 25 °C(lit.) |
| Boiling Point | 120 °C (2 mmHg) |
| Storage Condition | Store in a sealed container in a cool, dry place w |
| HTC | 2914700090 |
| SMILES | O=C(c1ccccc1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H8F2O/c14-10-7-4-8-11(15)12(10)13(16)9-5-2-1-3-6-9/h1-8H |
| InChI Key | KTRGJHDNHIPMEY-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2',6'-Difluoroacetophenone | 13670-99-0 | 2A-9002101 |
| 2,6-Difluoroaniline | 5509-65-9 | 2A-9002102 |
| 2,6-Difluoroanisole | 437-82-1 | 2A-9002103 |
| 2,6-Difluorobenzamide | 18063-03-1 | 2A-9002106 |
| 2,6-Difluorobenzoic acid | 385-00-2 | 2A-9002108 |
| 2,6-Difluorobenzyl alcohol | 19064-18-7 | 2A-9002110 |
| 2,6-Difluorobenzyl chloride | 697-73-4 | 2A-9002111 |
| 2,6-Difluorobenzylamine | 69385-30-4 | 2A-9002112 |
| 2,6-Difluorobenzylbromide | 85118-00-9 | 2A-9002113 |
| 2,6-Difluorocinnamic acid | 102082-89-3 | 2A-9002114 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA