
CAS Number135-12-6
Synonyms(4-chloro-2-nitro-phenyl)-(4-chloro-phenyl)-ether; (4-Chlor-2-nitro-phenyl)-(4-chlor-phenyl)-aether; 4,4'-DICHLORO-2-NITRODIPHENYL ETHER; EINECS 205-176-4; Ether,4-chloro-2-nitrophenyl p-chlorophenyl; 4-CHLOROPHENYL 4-CHLORO-2-NITROPHENYL ETHER; 4.4'-Dichlor-2-nitro-diphenylaether; Benzene,4-chloro-1-(4-chlorophenoxy)-2-nitro; 4,4'-Dichlor-2-nitrodifenylether; 4-Chloro-2-nitrophenyl p-chlorophenyl ether
Molecular FormulaC12H7Cl2NO3
Molecular Weight284.1
Purity98.00%
Density1.451g/cm3
Boiling Point363ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 135-12-6 |
| Catalog No. | 2A-9020744 |
| Chinese Name | 4,4'-二氯-2-硝基二苯醚 |
| Synonyms | (4-chloro-2-nitro-phenyl)-(4-chloro-phenyl)-ether; (4-Chlor-2-nitro-phenyl)-(4-chlor-phenyl)-aether; 4,4'-DICHLORO-2-NITRODIPHENYL ETHER; EINECS 205-176-4; Ether,4-chloro-2-nitrophenyl p-chlorophenyl; 4-CHLOROPHENYL 4-CHLORO-2-NITROPHENYL ETHER; 4.4'-Dichlor-2-nitro-diphenylaether; Benzene,4-chloro-1-(4-chlorophenoxy)-2-nitro; 4,4'-Dichlor-2-nitrodifenylether; 4-Chloro-2-nitrophenyl p-chlorophenyl ether |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.1 |
| Purity | 98.00 |
| Density | 1.451g/cm3 |
| Boiling Point | 363ºC at 760mmHg |
| Storage Condition | Warehouse is low temperature, ventilated and dry |
| HTC | 2909309090 |
| MDL Number | MFCD00024326 |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H7Cl2NO3/c13-8-1-4-10(5-2-8)18-12-6-3-9(14)7-11(12)15(16)17/h1-7H |
| InChI Key | XEGBVDXTOVJCSJ-UHFFFAOYSA-N |
| MSDS | msds/20744_1_135_12_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzil | 134-81-6 | 2A-9020735 |
| 4-Chlorobenzhydrylchloride | 134-83-8 | 2A-9020736 |
| 4-Methylbenzophenone | 134-84-9 | 2A-9020737 |
| 4-Chlorobenzophenone | 134-85-0 | 2A-9020738 |
| 4-(4-Aminoanilino)-3-nitrobenzenesulphonic acid | 135-11-5 | 2A-9020743 |
| Cupferron | 135-20-6 | 2A-9020746 |
| Pentacene | 135-48-8 | 2A-9020747 |
| Disodium 3-aminonaphthalene-2,7-disulphonate | 135-50-2 | 2A-9020748 |
| Disodium 2-naphthol-3,6-disulfonate | 135-51-3 | 2A-9020749 |
| Sodium 2,3-dihydroxynaphthalene-6-sulfonate | 135-53-5 | 2A-9020750 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA