
CAS Number134-80-5
Synonyms1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride (1:1); Prefamone; Keramik; Keramin; Diethylpropione hydrochloride; 2-(diéthylamino)-1-phénylpropan-1-one chlorhydrate; 2-(Diethylamino)-1-phenyl-1-propanone hydrochloride (1:1); 2-(Diethylamino)-1-phenylpropan-1-onhydrochlorid; Diethylpropion Hydrochloride; Regenon; ANOREX; Danylen; Frekentine; Tylinal; 2-(diethylamino)-1-phenylpropan-1-one,hydrochloride; EINECS 205-156-5; 2-(diethylamino)-1-phenylpropan-1-one hydrochloride; 2-Diethylaminopropiophenone Hydrochloride; a-Benzoyltriethylamine Hydrochloride; Anfamon; 2-(Diethylamino)-1-phenylpropan-1-one hydrochloride (1:1); UNII:19V2PL39NG; Amfepramone HCL; Magrene; Modulor; Parabolin
Molecular FormulaC13H20ClNO
Molecular Weight274.76
Purity98.00%
Density0.972g/cm3
Boiling Point292ºC at 760mmHg
Melting Point180-181ºC
Appearanceliquid
EINECS200-659-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 134-80-5 |
| Catalog No. | 2A-9020734 |
| Chinese Name | 盐酸安非拉酮 |
| Synonyms | 1-Propanone, 2-(diethylamino)-1-phenyl-, hydrochloride (1:1); Prefamone; Keramik; Keramin; Diethylpropione hydrochloride; 2-(diéthylamino)-1-phénylpropan-1-one chlorhydrate; 2-(Diethylamino)-1-phenyl-1-propanone hydrochloride (1:1); 2-(Diethylamino)-1-phenylpropan-1-onhydrochlorid; Diethylpropion Hydrochloride; Regenon; ANOREX; Danylen; Frekentine; Tylinal; 2-(diethylamino)-1-phenylpropan-1-one,hydrochloride; EINECS 205-156-5; 2-(diethylamino)-1-phenylpropan-1-one hydrochloride; 2-Diethylaminopropiophenone Hydrochloride; a-Benzoyltriethylamine Hydrochloride; Anfamon; 2-(Diethylamino)-1-phenylpropan-1-one hydrochloride (1:1); UNII:19V2PL39NG; Amfepramone HCL; Magrene; Modulor; Parabolin |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 274.76 |
| Purity | 98.00 |
| Density | 0.972g/cm3 |
| Boiling Point | 292ºC at 760mmHg |
| Melting Point | 180-181ºC |
| Appearance | liquid |
| Storage Condition | Controlled Substance, -20°C Freezer |
| EINECS | 200-659-6 |
| HTC | 2922399090 |
| SMILES | O=C(C(CCC)NC([2H])([2H])[2H])C1=CC(OCO2)=C2C=C1.[H]Cl |
| InChI | 1S/C13H17NO3.ClH/c1-3-4-10(14-2)13(15)9-5-6-11-12(7-9)17-8-16-11;/h5-7,10,14H,3-4,8H2,1-2H3;1H/i2D3; |
| InChI Key | WEFFVTZHXLDTJV-MUTAZJQDSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/20734_1_134_80_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Aminonaphthalene | 134-32-7 | 2A-9020724 |
| 4-Acetamido-5-hydroxynaphthalene-2,7-disulphonic acid | 134-34-9 | 2A-9020725 |
| 6,6'-Ureylene-bis(1-naphthol-3-sulfonic acid) | 134-47-4 | 2A-9020727 |
| Acridin-9-amine hydrochloride | 134-50-9 | 2A-9020728 |
| N,N-Diethyl-3-methylbenzamide | 134-62-3 | 2A-9020730 |
| Benzil | 134-81-6 | 2A-9020735 |
| 4-Chlorobenzhydrylchloride | 134-83-8 | 2A-9020736 |
| 4-Methylbenzophenone | 134-84-9 | 2A-9020737 |
| 4-Chlorobenzophenone | 134-85-0 | 2A-9020738 |
| 4-(4-Aminoanilino)-3-nitrobenzenesulphonic acid | 135-11-5 | 2A-9020743 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA