
CAS Number130-86-9
Synonyms7-Methyl-6,8,9,16-tetrahydrobis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-15(7H)-one; Biflorine; EINECS 204-999-6; 4,6,7,14-Tetrahydro-5-methyl-bis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-13(5H)-one; BIFLORIN; Hypercorine; 4,6,7,14-Tetrahydro-5-Methyl; Tangeratin; Corydinine; Corydalis C
Molecular FormulaC20H19NO5
Molecular Weight353.37
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point547.5±49.0 °C at 760 mmHg
Melting Point211ºC
Appearanceoff-white solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 130-86-9 |
| Catalog No. | 2A-9020657 |
| Chinese Name | 原阿片碱 |
| Synonyms | 7-Methyl-6,8,9,16-tetrahydrobis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-15(7H)-one; Biflorine; EINECS 204-999-6; 4,6,7,14-Tetrahydro-5-methyl-bis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-13(5H)-one; BIFLORIN; Hypercorine; 4,6,7,14-Tetrahydro-5-Methyl; Tangeratin; Corydinine; Corydalis C |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 547.5±49.0 °C at 760 mmHg |
| Melting Point | 211ºC |
| Appearance | off-white solid |
| Water Solubility | Water solubility: insoluble; water solubility: 8.9 |
| Storage Condition | Refrigerator |
| Packaging | III |
| Application | Protopine is an isoquinoline alkaloid that often exists in some plants in northeastern Asia. It is mainly used for research on anti-tumor and anti-inflammatory activities. |
| MDL Number | C20H19NO5 |
| SMILES | CN1CCc2cc3c(cc2C(=O)Cc2ccc4c(c2C1)OCO4)OCO3 |
| InChI | InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3 |
| InChI Key | GPTFURBXHJWNHR-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/20657_1_130_86_9.pdf |
| Transport Info | Product Name: Proto-opiate base |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| 1,5-Dihydroxy-4,8-dinitroanthraquinone | 128-91-6 | 2A-9020621 |
| 1,4-Diamino anthraquinone | 128-95-0 | 2A-9020623 |
| 1-Chloro-2-methylanthraquinone | 129-35-1 | 2A-9020632 |
| 1-Hydroxy anthraquinone | 129-43-1 | 2A-9020634 |
| 1,5-Diaminoanthraquinone | 129-44-2 | 2A-9020635 |
| Sodium anthraquinone-2-sulfonate | 131-08-8 | 2A-9020661 |
| 2-Chloroanthraquinone | 131-09-9 | 2A-9020662 |
| 2,6-Diaminoanthraquinone | 131-14-6 | 2A-9020666 |
| 1,4-Dihydroxyanthraquinone-2-sulfonic acid | 145-48-2 | 2A-9020959 |
| 1,5-Diamino-4,8-dihydroxyanthraquinone | 145-49-3 | 2A-9020960 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA