
CAS Number344-20-7
Synonyms2,5-BIS(TRIFLUOROMETHYL)BENZYL AMINE; 4-Fluor-2.6-dibrom-1-hydroxy-benzol; EINECS 206-451-1; MFCD00002317; 2,6-dibromo-4-fluoro-phenol; 2,6-Dibrom-4-fluor-phenol; 2,6-dibromo-4-flurophenol; Phenol,2,6-dibromo-4-fluoro; 2,6-Dibromo-4-fluorophenol
Molecular FormulaC6H3Br2FO
Molecular Weight269.894
Purity98%
Density2.2±0.1 g/cm3
Boiling Point219.5±35.0 °C at 760 mmHg
Melting Point55-57°C
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 344-20-7 |
| Catalog No. | 2A-9002048 |
| Chinese Name | 2,6-二溴-4-氟苯酚 |
| Synonyms | 2,5-BIS(TRIFLUOROMETHYL)BENZYL AMINE; 4-Fluor-2.6-dibrom-1-hydroxy-benzol; EINECS 206-451-1; MFCD00002317; 2,6-dibromo-4-fluoro-phenol; 2,6-Dibrom-4-fluor-phenol; 2,6-dibromo-4-flurophenol; Phenol,2,6-dibromo-4-fluoro; 2,6-Dibromo-4-fluorophenol |
| Molecular Formula | C6H3Br2FO |
| Molecular Weight | 269.894 |
| Purity | 98 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 219.5±35.0 °C at 760 mmHg |
| Melting Point | 55-57°C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | 2~8℃ |
| HTC | 2908199090 |
| SMILES | Oc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C6H3Br2FO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H |
| InChI Key | RRAZCUUOWIDAJS-UHFFFAOYSA-N |
| MSDS | msds/2048_1_344_20_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Bis(2,2,2-trifluoroethoxy)-3-bromobenzonitrile | 175204-13-4 | 2A-9002033 |
| 2,6-Bis(2,2,2-trifluoroethoxy)benzonitrile | 93624-57-8 | 2A-9002034 |
| 2,6-Dibromo-4-(trifluoromethoxy)aniline | 88149-49-9 | 2A-9002045 |
| 2,6-Dibromo-4-fluoroaniline | 344-18-3 | 2A-9002046 |
| 2,6-Dibromo-4-fluoroiodobenzene | 62720-29-0 | 2A-9002047 |
| 2,6-Dibromo-4-methylaniline | 6968-24-7 | 2A-9002050 |
| 2,6-Dibromophenol | 608-33-3 | 2A-9002051 |
| 2',6'-Dichloro-3'-fluoroacetophenone | 290835-85-7 | 2A-9002054 |
| 2,6-Dichloro-3-fluorobenzoic acid | 178813-78-0 | 2A-9002055 |
| 2,6-Dichloro-3-methylphenylamine | 64063-37-2 | 2A-9002056 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA