
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53130-44-2 |
| Catalog No. | 2A-9002036 |
| Chinese Name | 2,6-双(三氟甲基)苯甲酰氯 |
| Synonyms | jrd-0356; MFCD00061228 |
| Molecular Formula | C9H3O1Cl1F6 |
| Molecular Weight | 276.57 |
| Purity | 98 |
| Density | 1.512g/cm3 |
| Boiling Point | 219.4ºC at 760mmHg |
| Appearance | colorless liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| HTC | 2916399090 |
| MDL Number | MFCD00061228 |
| SMILES | O=C(Cl)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H3ClF6O/c10-7(17)6-4(8(11,12)13)2-1-3-5(6)9(14,15)16/h1-3H |
| InChI Key | NQMCJGTVZMBTDS-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/2036_1_53130_44_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,5-Dichlorobenzaldehyde | 6361-23-5 | 2A-9001972 |
| 2,5-Dichlorophenylboronic acid | 135145-90-3 | 2A-9001978 |
| 2,5-Difluorobenzaldehyde | 2646-90-4 | 2A-9001987 |
| 2,5-Difluorophenylboronic acid | 193353-34-3 | 2A-9002005 |
| 2,5-Dimethoxyphenylboronic acid | 107099-99-0 | 2A-9002020 |
| 2',6'-Dichloro-4'-(trifluoromethyl)acetophenone | 175205-88-6 | 2A-9002058 |
| 2,6-Dichloro-4-(trifluoromethyl)benzamide | 157021-70-0 | 2A-9002059 |
| 2,6-Dichloro-4-(trifluoromethyl)benzene sulphonyl chloride | 175205-76-2 | 2A-9002060 |
| 2,6-Dichloro-4-(trifluoromethyl)benzonitrile | 157021-61-9 | 2A-9002061 |
| 2,6-Dichloro-4-(trifluoromethyl)phenylacetic acid | 132992-36-0 | 2A-9002062 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA