
CAS Number29477-83-6
SynonymsLycoricidinol; Lycoricidin-A; (2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one; (2S,3R,4S,4aR)-2,3,4,7-Tetrahydroxy-3,4,4a,5-tetrahydro[1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one; Narciclasine
Molecular FormulaC14H13NO7
Molecular Weight307.255
Density1.9±0.1 g/cm3
Boiling Point733.8±60.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29477-83-6 |
| Catalog No. | 2A-0202723 |
| Chinese Name | 水仙环素 |
| Synonyms | Lycoricidinol; Lycoricidin-A; (2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one; (2S,3R,4S,4aR)-2,3,4,7-Tetrahydroxy-3,4,4a,5-tetrahydro[1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one; Narciclasine |
| Molecular Formula | C14H13NO7 |
| Molecular Weight | 307.255 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 733.8±60.0 °C at 760 mmHg |
| Storage Condition | -20°C |
| Application | Narciclasine is a plant growth regulator. Narciclasine regulates the Rho/Rho kinase/LIM kinase/cofilin signaling pathway, greatly increases the activity of GTPase RhoA and induces actin stress fiber f |
| PubChem ID | 10726 |
| SMILES | O=C1NC2C(=CC(O)C(O)C2O)c2cc3c(c(O)c21)OCO3 |
| InChI | InChI=1S/C14H13NO7/c16-6-1-5-4-2-7-13(22-3-21-7)11(18)8(4)14(20)15-9(5)12(19)10(6)17/h1-2,6,9-10,12,16-19H,3H2,(H,15,20)/t6-,9+,10+,12-/m0/s1 |
| InChI Key | LZAZURSABQIKGB-AEKGRLRDSA-N |
| Transport Info | Product name: Narciclasine |
| Related Products in Industrial Applications | ||
|---|---|---|
| 11-(Methylsulfinyl)undecylglucosinolate | 186037-18-3 | 2A-0202718 |
| Monocrotalin N-oxide | 35337-98-5 | 2A-0202719 |
| Morindone-6-O-β-D-primeveroside | 60450-21-7 | 2A-0202720 |
| Moringin | 73255-40-0 | 2A-0202721 |
| MULTIFLORINE | 529-80-6 | 2A-0202722 |
| Neoglucobrassicin | 5187-84-8 | 2A-0202724 |
| OENIN CHLORIDE | 7228-78-6 | 2A-0202725 |
| α-Onocerin | 511-01-03 | 2A-0202726 |
| Pelargonidin chloride | 134-04-03 | 2A-0202727 |
| Pelargonidin 3,5-diglucoside chloride | 17334-58-6 | 2A-0202728 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA