
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19725-82-7 |
| Catalog No. | 2A-0201889 |
| Chinese Name | 5-溴-2-(羧基甲基)苯甲酸 |
| Synonyms | 5-BROMO-HOMOPHTHALIC ACID; 5-bromo-2-carboxymethylbenzoic acid; 4-Brom-homophthalsaeure; 4-bromo-2-carboxyphenylacetic acid |
| Molecular Formula | C9H7O4Br1 |
| Molecular Weight | 259.06 |
| Purity | 98% |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2917399090 |
| PubChem ID | 15665971 |
| MDL Number | MFCD11877995 |
| SMILES | O=C(O)Cc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C9H7BrO4/c10-6-2-1-5(3-8(11)12)7(4-6)9(13)14/h1-2,4H,3H2,(H,11,12)(H,13,14) |
| InChI Key | VFYONOBJKYTLNC-UHFFFAOYSA-N |
| MSDS | msds/203262_1_19725_82_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (8R,9S,10R,13S,14S,17R,E)-13-ethyl-17-ethynyl-3-(hydroxyimino)-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl acetate | 107382-52-5 | 2A-0201848 |
| 13β-ethyl-3-oxo-18,19-dinor-17α-pregn-4-en-20-yn-17-yl acetate (as per EP) | 13732-69-9 | 2A-0201851 |
| (1-ISOPROPYL-PIPERIDIN-4-YLMETHYL)-METHYL-AMINE | 876716-04-0 | 2A-1201866 |
| 1,1-Dimethylethyl 27-oxo-4,7,10,13,16,19,22,25-octaoxaheptacosanoate | 1334177-84-2 | 2A-0201876 |
| 2-Chlorotritylchloride resin | 934816-82-7 | 2A-0201877 |
| ZINC ACETYLACETONATE HYDRATE | 14363-15-6 | 2A-0201895 |
| Dimethylcopperlithium | 15681-48-8 | 2A-0201914 |
| oxolan-2-ylmethanesulfonamide | 859998-68-8 | 2A-0201915 |
| SILVER(II) FLUORIDE | 7783-95-1 | 2A-1201917 |
| Propolis Extract | 2A-4201933 | 2A-0201945 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA