
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 910036-90-7 |
| Catalog No. | 2A-1201870 |
| Chinese Name | (5-吗啉噻吩-2-基)甲醇 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 |
| Purity | 98% |
| Density | 1.277g/cm3 |
| Boiling Point | 388.562ºC at 760 mmHg |
| HTC | 2934999090 |
| PubChem ID | 31271902 |
| MDL Number | C9H13NO2S |
| SMILES | OCc1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C9H13NO2S/c11-7-8-1-2-9(13-8)10-3-5-12-6-4-10/h1-2,11H,3-7H2 |
| InChI Key | ARHCBVQYTBJJPS-UHFFFAOYSA-N |
| MSDS | msds/203260_1_910036_90_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-Propenoic acid, 2-methyl-, 1,6-hexanediyl ester, polymer with dodecyl 2-methyl-2-propenoate, 2-ethylhexyl 2-methyl-2-propenoate and 2-ethylhexyl 2-propenoate | 118677-03-5 | 2A-4201220 |
| (3-PYRID-4-YLPHENYL)METHANOL | 85553-55-5 | 2A-0201348 |
| (3-chloro-5-fluoropyridin-2-yl)Methanol | 1227563-98-5 | 2A-0201560 |
| isopropylideneaMinooxyethanol | 83495-51-6 | 2A-4201567 |
| 2-diazo-1-naphthol-5-sulfonic acid, ester with pyrogallol/acetone resin | 68584-99-6 | 2A-4201657 |
| [4-(1H-IMIDAZOL-1-YLMETHYL)PHENYL]METHANOL | 103573-92-8 | 2A-0202010 |
| Liquid Polymer Alkylamine | 2A-0202298 | 2A-1202298 |
| Romosozumab | 909395-70-6 | 2A-4202417 |
| Naftopidil + Dutasteride | 57149-07-2 | 2A-3202534 |
| 1-(2-Amino-5-hydroxyphenyl)propan-1-one | 35364-15-9 | 2A-0202563 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA