
CAS Number78603-93-7
SynonymsMFCD07368633; (2R)-2-amino-1,1-diphenylpropan-1-ol; (2R)-2-Amino-1,1-diphenyl-1-propanol; R-2-amino-1,1-diphenylpropanol
Molecular FormulaC15H17O1N1
Molecular Weight227.31
Purity98%
Density1.1±0.1 g/cm3
Boiling Point407.8±40.0 °C at 760 mmHg
Melting Point102-105 °C(lit.)
AppearanceWhite to light yellow crystal powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78603-93-7 |
| Catalog No. | 2A-9000203 |
| Chinese Name | (R)-2-氨基-1,2-联苯-1-丙醇 |
| Synonyms | MFCD07368633; (2R)-2-amino-1,1-diphenylpropan-1-ol; (2R)-2-Amino-1,1-diphenyl-1-propanol; R-2-amino-1,1-diphenylpropanol |
| Molecular Formula | C15H17O1N1 |
| Molecular Weight | 227.31 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 407.8±40.0 °C at 760 mmHg |
| Melting Point | 102-105 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Room temperature, dry |
| HTC | 2922199090 |
| MDL Number | MFCD02677967 |
| SMILES | CC(N)C(O)(c1ccccc1)c1ccccc1 |
| InChI Key | FMBMNSFOFOAIMZ-GFCCVEGCSA-N |
| Hazard Symbols | Xi |
| Risk Codes | 36/37/38 |
| Safety Description | 26-36 |
| MSDS | msds/203_1_78603_93_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-1-N-Boc-3-hydroxypyrrolidine | 109431-87-0 | 2A-9000198 |
| (R)-1-Tosyloxy-2,3-propanediol | 41274-09-3 | 2A-9000199 |
| (R)-2-(4-Ethyl-2,3-dioxopiperazine-1-carboxamido)-2-phenylacetic acid | 63422-71-9 | 2A-9000200 |
| (R)-2,3-Bis(1-methylethyl)amino-1-phenylpropyl-4-methylphenol | 2A-100201 | 2A-9000201 |
| (R)-2-[(R)-1-Ethoxy-1-oxo-4-phenylbutan-2-yl-amino]propanoic acid | 2A-100202 | 2A-9000202 |
| (R)-2-Aminosuccinic acid | 1783-96-6 | 2A-9000204 |
| (R)-2-Bromo-2-chloro-2-phenylacetic acid | 2A-100205 | 2A-9000205 |
| (R)-2-Chlorosuccinic acid | 3972-40-5 | 2A-9000206 |
| (R)-2-Flubiprofen | 2A-100207 | 2A-9000207 |
| (R)-2-Hydroxy-3-phenylpropionic acid | 7326-19-4 | 2A-9000208 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA