
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1189169-37-6 |
| Catalog No. | 2A-1201167 |
| Chinese Name | 1-(5-溴嘧啶-2-基)乙酮 |
| Synonyms | 1-(5-bromopyrimidin-2-yl)ethan-1-one; 1-(5-Bromo-2-pyrimidinyl)ethanone |
| Molecular Formula | C6H5O1N2Br1 |
| Molecular Weight | 201.02 |
| Purity | 98% |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 318.6±34.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933599090 |
| PubChem ID | 126660611 |
| MDL Number | MFCD18909512 |
| SMILES | CC(=O)c1ncc(Br)cn1 |
| InChI | InChI=1S/C6H5BrN2O/c1-4(10)6-8-2-5(7)3-9-6/h2-3H,1H3 |
| InChI Key | NZGSEUQFYKCKRU-UHFFFAOYSA-N |
| MSDS | msds/202912_1_1189169_37_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tesamorelin | 218949-48-5 | 2A-4201159 |
| ARG-GLY-ASP | 99896-85-2 | 2A-4201161 |
| S-(1-Hydroxy-2-methylpropan-2-yl) methanesulfonothioate | 2127875-65-2 | 2A-1201163 |
| (1-methoxycyclopropyl)methanamine hydrochloride | 1574118-00-5 | 2A-1201164 |
| 1,3-DIFLUOROPROPAN-2-AMINE HCL | 760-25-8 | 2A-0201171 |
| 4-TERT-BUTOXY-BENZYLAMINE | 84697-13-2 | 2A-1201177 |
| 1,1-Dimethylethyl N-[(5-amino-1-methyl-1H-pyrazol-4-yl)methyl]carbamate | 2163447-93-4 | 2A-0201193 |
| Tert-Butyl N-[3-(Benzylamino)Propyl]Carbamate(WXC03618) | 90914-08-2 | 2A-0201191 |
| POLY(DIMETHYLSILANE) | 30107-43-8 | 2A-4201197 |
| dimethoxymethylpropyl-Silane | 18173-73-4 | 2A-4201198 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA