
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51877-54-4 |
| Catalog No. | 2A-1201134 |
| Chinese Name | 环氧乙烷-2-羧酸钾 |
| Synonyms | potassium,oxirane-2-carboxylate; Potassium 2-oxiranecarboxylate; 2-Oxiranecarboxylic acid, potassium salt (1:1) |
| Molecular Formula | C3H3KO3 |
| Molecular Weight | 195.21 |
| Purity | 98% |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2918990090 |
| PubChem ID | 152063883 |
| SMILES | O=C([O-])C1CO1.[K+] |
| InChI | InChI=1S/C3H4O3.K/c4-3(5)2-1-6-2;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| InChI Key | CMQCDPNYSJUSEH-UHFFFAOYSA-M |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/202884_1_51877_54_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Methyl-2,3-dihydrobenzofuran-2-carboxylic acid | 31468-94-7 | 2A-1201096 |
| 3-dihydrobenzofuran-2-yl)Methanamine | 21214-11-9 | 2A-1201098 |
| 2-METHYL-1,3-BENZOTHIAZOLE-6-SULPHONYL CHLORIDE | 21431-13-0 | 2A-0201108 |
| 4-fluorobenzofuran-2-carboxylic acid | 1408060-30-9 | 2A-1201101 |
| 5,5-dimethyltetrahydrofuran-3-amine | 1390638-73-9 | 2A-0201132 |
| 2-Methyloxirane-2-carboxylic acid | 38649-35-3 | 2A-1201135 |
| 4-chloro-3-methyl-1-benzothiophene-2-sulfonyl chloride | 752135-45-8 | 2A-0201145 |
| 1H-Pyrazole-4-methanamine,5-amino-1-methyl-(9CI) | 753444-70-1 | 2A-0201144 |
| 4-Amino-1,3-dihydroisobenzofuran | 98475-10-6 | 2A-1201162 |
| DIHYDRO-4,4-DIMETHYL-2(3H)-FURANONE | 13861-97-7 | 2A-1201175 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA