CAS Number3898-66-6
Synonyms4-methoxylhomophthalic acid; Nitrohomophthalic acid; 2-carboxymethyl-5-nitro-benzoic acid; 2-carboxy-4-nitrobenzeneacetic acid; 2-carboxymethyl-5-methoxy-benzoic acid; 2-(Carboxymethyl)-5-nitrobenzoic acid; 4-methoxyhomophthalic acid; 5-methoxyhomophthalic acid; 4-nitro-homophthalic acid; 5-nitrohomophthalic acid
Molecular FormulaC9H7NO6
Molecular Weight225.16
Purity98%%
Density1.6±0.1 g/cm3
Boiling Point484.0±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3898-66-6 |
| Catalog No. | 2A-1200867 |
| Chinese Name | 2-(羧甲基)-5-硝基苯甲酸 |
| Synonyms | 4-methoxylhomophthalic acid; Nitrohomophthalic acid; 2-carboxymethyl-5-nitro-benzoic acid; 2-carboxy-4-nitrobenzeneacetic acid; 2-carboxymethyl-5-methoxy-benzoic acid; 2-(Carboxymethyl)-5-nitrobenzoic acid; 4-methoxyhomophthalic acid; 5-methoxyhomophthalic acid; 4-nitro-homophthalic acid; 5-nitrohomophthalic acid |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.16 |
| Purity | 98% |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 484.0±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2917399090 |
| PubChem ID | 38387296 |
| MDL Number | MFCD04035583 |
| SMILES | O=C(O)Cc1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C9H7NO6/c11-8(12)3-5-1-2-6(10(15)16)4-7(5)9(13)14/h1-2,4H,3H2,(H,11,12)(H,13,14) |
| InChI Key | QHIFWNXJOHQQTH-UHFFFAOYSA-N |
| MSDS | msds/202683_1_3898_66_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| diethyl [fluoro(methanesulfonyl)methyl]phosphonate | 2922230-39-3 | 2A-0200853 |
| 3-(DIMETHYLAMINO)ACRYLONITRILE | 35520-41-3 | 2A-0200878 |
| 6-Bromo-5-fluoro-3,4-dihydro-1H-quinolin-2-one | 1404367-69-6 | 2A-1200859 |
| 5-fluoro-3,4-dihydroquinolin-2(1H)-one | 116434-95-8 | 2A-0200879 |
| 7-Bromo-2,3,4,5-tetrahydro-1H-benzo[b]azepine hydrochloride | 321435-99-8 | 2A-1200864 |
| 1,3,5,7-Tetrabromoadamantane | 7314-86-5 | 2A-1200872 |
| 2-Amino-4-Bromobenzoic Acid Hexyl Ester | 1274757-54-8 | 2A-0200895 |
| Cyclopropyl chloroformate | 52107-21-8 | 2A-1200889 |
| 3-Chloro-1-methyl-1H-pyrazol-5-amine | 167408-80-2 | 2A-1200891 |
| tert-Butyl 2-amino-4-bromobenzoate | 890315-73-8 | 2A-1200892 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS