
CAS Number2581-43-3
Synonyms1,4-dicarboxybenzene; 1,4-phenylene bistosylate; 1,4-bezenedicarboxylic acid; 1,4-Benzenecarboxylic acid; benzene-1,4-dicarboxylate dianion; benzene-1,4-dicarboxylate ion; p-benzenedicarboxylate dianion; ditosylate of hydroquinone; Benzene para dicarboxylic acid; benzene-1,4-dicarboxylate; 1,4-Benzenedicarboxylate
Molecular FormulaC20H18O6S2
Molecular Weight418.491
Purity98%%
Density1.352g/cm3
Boiling Point591.6ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2581-43-3 |
| Catalog No. | 2A-1200648 |
| Chinese Name | 1,4-Benzenediol,1,4-bis(4-methylbenzenesulfonate) |
| Synonyms | 1,4-dicarboxybenzene; 1,4-phenylene bistosylate; 1,4-bezenedicarboxylic acid; 1,4-Benzenecarboxylic acid; benzene-1,4-dicarboxylate dianion; benzene-1,4-dicarboxylate ion; p-benzenedicarboxylate dianion; ditosylate of hydroquinone; Benzene para dicarboxylic acid; benzene-1,4-dicarboxylate; 1,4-Benzenedicarboxylate |
| Molecular Formula | C20H18O6S2 |
| Molecular Weight | 418.491 |
| Purity | 98% |
| Density | 1.352g/cm3 |
| Boiling Point | 591.6ºC at 760mmHg |
| HTC | 2904100000 |
| PubChem ID | 474335 |
| MDL Number | MFCD00186626 |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H18O6S2/c1-15-3-11-19(12-4-15)27(21,22)25-17-7-9-18(10-8-17)26-28(23,24)20-13-5-16(2)6-14-20/h3-14H,1-2H3 |
| InChI Key | VTSNEDSSUJGUGK-UHFFFAOYSA-N |
| MSDS | msds/202534_1_2581_43_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromophenyl 4-methylphenyl sulfone | 5184-70-3 | 2A-1200643 |
| 1-(4-BROMO-PHENYL)-PIPERIDIN-2-ONE | 27471-43-8 | 2A-0200657 |
| 1-(4-CHLORO-PHENYL)-PIPERIDIN-2-ONE | 27471-37-0 | 2A-1200645 |
| 1-bromo-4-(4-methylphenyl)sulfonyloxy-benzene | 6324-15-8 | 2A-1200646 |
| (O-METHANESULFONYL)-4-BROMOPHENOL | 68574-35-6 | 2A-0200655 |
| 2-chloroacetoacetamide | 67271-66-3 | 2A-1200649 |
| 2,3-Difluoro-6-(methoxymethoxy)benzoic acid | 2179038-37-8 | 2A-1200658 |
| Ethanimidamide, 2,2,2-trichloro-N-(1-iminoethyl)- | 63639-66-7 | 2A-0200669 |
| (5RS)-5-Ethyl-2,6-diimino-5-phenyl-1,2,5,6-tetrahydropyrimidin-4(3H)-one | 69125-70-8 | 2A-1200665 |
| Copper-zinc alloy | 63338-02-3 | 2A-1200666 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA