
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 636-31-7 |
| Catalog No. | 2A-2199937 |
| Chinese Name | 1,2,4,5-四碘苯 |
| Synonyms | 1,2,4,5-Tetrajod-benzol; Benzene,1,2,4,5-tetraiodo; 1,2,4,5-tetraiodobenzol; 1,2,4,5-tetraiodo-benzene |
| Molecular Formula | C6H2I4 |
| Molecular Weight | 581.7 |
| Density | 3.273g/cm3 |
| Boiling Point | 425.7ºC at 760 mmHg |
| Appearance | Yellow to red to brown powder or crystal |
| Storage Condition | Room temperature, inert gas, protected from light |
| HTC | 2903999090 |
| MDL Number | MFCD02684763 |
| SMILES | Ic1cc(I)c(I)cc1I |
| InChI | InChI=1S/C6H2I4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
| InChI Key | QHODZFPKHGDLOS-UHFFFAOYSA-N |
| MSDS | msds/201941_1_636_31_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dimethoxybenzaldoxime | 318774-34-7 | 2A-2199462 |
| 2,4-Dinitrophenyl butyrate, | 24273-19-6 | 2A-2199464 |
| 5-Bromo-2,4-dimethylpyrimidine | 69696-37-3 | 2A-2199566 |
| 5-AMINO-2,4-DIFLUOROPHENOL | 113512-71-3 | 2A-1199699 |
| 1,5-dibromo-2,4-diiodobenzene | 96843-23-1 | 2A-2199923 |
| 2,4-Dichloro-5-(iodomethyl)pyrimidine | 7627-44-3 | 2A-1199963 |
| Gibberellin | 10365-11-4 | 2A-2199971 |
| Ethephon | 82375-49-3 | 2A-2199973 |
| bispyribac-sodium5%+penoxsulam 2%+quinclorac18% OD | 125401-92-5+219714-96-2+84087-01-4 | 2A-2199989 |
| metamifop 6%+propanil 32% EC | 256412-89-2+709-98-8 | 2A-2199993 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA