
CAS Number3166-74-3
Synonyms2,4-DIHYDROXY-NICOTINIC ACID; Benzeneethanamine, 2,5-dimethoxy-, hydrochloride (1:1); 2-(2,5-Dimethoxyphenyl)ethanamine hydrochloride (1:1); 2,5-dimethoxy phenethylamine hydrochloride; Ethylamine, β-(2,5-dimethoxyphenyl)-, hydrochloride; 2,5-Dimethoxy-phenaethylamin,Hydrochlorid; Phenethylamine,2,5-dimethoxy-,hydrochloride; 2,5-dimethoxy-phenethylamine,hydrochloride; 2,5-Dimethoxy phenethylamine hydorchloride; MFCD01708299
Molecular FormulaC10H16ClNO2
Molecular Weight217.693
Purity98%
Density1.041 g/cm3
Boiling Point301.5ºC
AppearanceWhite
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3166-74-3 |
| Catalog No. | 2A-9002019 |
| Chinese Name | 2,5-二甲氧基苯乙胺盐酸盐 |
| Synonyms | 2,4-DIHYDROXY-NICOTINIC ACID; Benzeneethanamine, 2,5-dimethoxy-, hydrochloride (1:1); 2-(2,5-Dimethoxyphenyl)ethanamine hydrochloride (1:1); 2,5-dimethoxy phenethylamine hydrochloride; Ethylamine, β-(2,5-dimethoxyphenyl)-, hydrochloride; 2,5-Dimethoxy-phenaethylamin,Hydrochlorid; Phenethylamine,2,5-dimethoxy-,hydrochloride; 2,5-dimethoxy-phenethylamine,hydrochloride; 2,5-Dimethoxy phenethylamine hydorchloride; MFCD01708299 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.693 |
| Purity | 98 |
| Density | 1.041 g/cm3 |
| Boiling Point | 301.5ºC |
| Appearance | White |
| HTC | 2922299090 |
| SMILES | COc1ccc(OC)c(CCN)c1.Cl |
| InChI | InChI=1S/C10H15NO2.Cl/c1-12-9-3-4-10(13-2)8(7-9)5-6-11;/h3-4,7H,5-6,11H2,1-2H3; |
| InChI Key | PJMQBIMLDBAWRK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dimethoxybenzenesulphonamide | 19116-90-6 | 2A-9002014 |
| 2,5-Dimethoxybenzenesulphonyl chloride | 1483-28-9 | 2A-9002015 |
| 2,5-Dimethoxybenzoic acid | 2785-98-0 | 2A-9002016 |
| 2,5-Dimethoxycinnamic acid | 10538-51-9 | 2A-9002017 |
| 2,5-Dimethoxyphenethylamine | 3600-86-0 | 2A-9002018 |
| 2,5-Dimethoxythiophenol | 1483-27-8 | 2A-9002021 |
| 2,5-Dimethyl-1,4-dithiane-2,5-diol | 55704-78-4 | 2A-9002023 |
| 2,5-Dimethylphenylmethylsulfone | 2A-102028 | 2A-9002028 |
| 2,5-Dimethylthiophenol | 4001-61-0 | 2A-9002031 |
| 2,6,6-Trimethyl-2-cyclohexene-1,4-dione | 1125-21-9 | 2A-9002032 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA