
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4212-65-1 |
| Catalog No. | 2A-2199795 |
| Chinese Name | D-xylulose 5-phosphate |
| Molecular Formula | C5H11O8P |
| Molecular Weight | 230.11 (free acid basis) |
| Purity | ≥90 (TLC) |
| Appearance | powder or crystals |
| HTC | 2919900090 |
| PubChem ID | 329750987 |
| MDL Number | MFCD30543842 |
| SMILES | OCC([C@@H](O)[C@H](O)COP(O)(O)=O)=O |
| InChI | 1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h4-6,8-9H,1-2H2,(H2,10,11,12)/t4-,5-/m1/s1 |
| InChI Key | FNZLKVNUWIIPSJ-RFZPGFLSSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352201 |
| MSDS | msds/201792_1_4212_65_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| O-β-D-Galactopyranosyl-(1-4)-O-β-D-glucopyranosyl-(1-4)-D-glucose | 90025-36-8 | 2A-2199790 |
| 4H-1-Benzopyran-4-one, 2-[3-(β-D-glucopyranosyloxy)-4-hydroxyphenyl]-3,5,7,8-tetrahydroxy- | 777080-67-8 | 2A-2199791 |
| L-GULOSE | 6027-89-0 | 2A-2199792 |
| D-RIBULOSE 5-PHOSPHATE | 551-85-9 | 2A-2199793 |
| 4-AMINOCINNAMIC ACID HYDROCHLORIDE | 54057-95-3 | 2A-2199794 |
| linamarin synthase | 37277-68-2 | 2A-2199797 |
| taxusin | 19605-80-2 | 2A-2199799 |
| 3,4,6-Tri-O-acetyl-1,2-O-(1-alloxyethylidene)-β-D-mannopyranose | 136944-74-6 | 2A-2199800 |
| P-Hydroxymandelonitrile | 13093-65-7 | 2A-2199801 |
| 1-methyl-4-prop-1-en-2-yl-cyclohex-2-en-1-ol | 22771-44-4 | 2A-2199803 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA