
CAS Number28269-03-6
Synonymstrans-1,2-diphenyl-cyclopropane; Dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate; 4-Oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester; trans dimethyl cyclopentanone 3,4-dicarboxylate; rac-trans-1,2-diphenylcyclopropane; diphenylcyclopropane; Dimethyl (1R,2R)-4-oxo-1,2-cyclopentanedicarboxylate; (1R,2R)-4-Oxo-cyclopentane-1,2-dicarboxylic acid dimethyl ester
Molecular FormulaC9H12O5
Molecular Weight200.19
Density1.2±0.1 g/cm3
Boiling Point299.0±40.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28269-03-6 |
| Catalog No. | 2A-1199745 |
| Chinese Name | (1R,2R)-rel-4-氧代环戊烷-1,2-二羧酸二甲酯 |
| Synonyms | trans-1,2-diphenyl-cyclopropane; Dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate; 4-Oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester; trans dimethyl cyclopentanone 3,4-dicarboxylate; rac-trans-1,2-diphenylcyclopropane; diphenylcyclopropane; Dimethyl (1R,2R)-4-oxo-1,2-cyclopentanedicarboxylate; (1R,2R)-4-Oxo-cyclopentane-1,2-dicarboxylic acid dimethyl ester |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 299.0±40.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918300090 |
| MDL Number | MFCD10001388 |
| SMILES | COC(=O)C1CC(=O)CC1C(=O)OC |
| InChI Key | GMKJWKXCHOWVDN-RNFRBKRXSA-N |
| MSDS | msds/201740_1_28269_03_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-METHYL-2,6-DIAZASPIRO[3.4]OCTANE | 135380-24-4 | 2A-2199688 |
| 4,4'-DIHYDROXY-BIPHENYL-2-CARBOXYLIC ACID | 53197-57-2 | 2A-2199689 |
| Methyl 9-Acridinecarboxylate | 5132-81-0 | 2A-1199711 |
| 1H-Pyrazol-4-amine, 1-(difluoromethyl)-, hydrochloride | 1221726-31-3 | 2A-1199728 |
| ethyl 1-(aminocarbonyl)cyclobutanecarboxylate | 1142198-19-3 | 2A-1199733 |
| 5-isothiocyanato-3-(trifluoromethyl) Picolinonitrile | 951735-87-0 | 2A-2199804 |
| 2-(2-fluoro-6-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 1599432-41-3 | 2A-2199805 |
| (Z)-5-Methoxy-1-[4-(triflurormethyl)phenyl]-1-pentanone O-(2-Aminoethyl)oxime Maleate | 917096-37-8 | 2A-2199903 |
| 3,4,9,10-Perylenetetracarboxylic acid, potassium salt (1:4) | 79915-93-8 | 2A-2199924 |
| Boronic acid,(4-[2,2':6',2''-terpyridin]-4'-ylphen | 381218-96-8 | 2A-2199946 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA