
CAS Number56882-52-1
SynonymsBenzoic acid,2,4-dichloro-,ethyl ester; 2,4-dichlorobenzoic acid ethyl ester; 2,4-Dichlor-benzoesaeure-aethylester; 2,4-dichlorobenzoyl ethylester; ethyl ester of 2,4-CBA
Molecular FormulaC9H8Cl2O2
Molecular Weight219.06500
Density1.305g/cm3
Boiling Point272.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56882-52-1 |
| Catalog No. | 2A-1199082 |
| Chinese Name | 2,4-二氯苯甲酸乙酯 |
| Synonyms | Benzoic acid,2,4-dichloro-,ethyl ester; 2,4-dichlorobenzoic acid ethyl ester; 2,4-Dichlor-benzoesaeure-aethylester; 2,4-dichlorobenzoyl ethylester; ethyl ester of 2,4-CBA |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.06500 |
| Density | 1.305g/cm3 |
| Boiling Point | 272.8ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2916399090 |
| SMILES | CCOC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O2/c1-2-13-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
| InChI Key | ZBBGAUHWTZKKQQ-UHFFFAOYSA-N |
| MSDS | msds/201031_1_56882_52_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2-[(2,4-dimethylphenyl)thio]-phenylamine hydrochloride | 1610527-50-8 | 2A-2198757 |
| 1H-Imidazole-1-ethanol, 2-(2,4-dichlorophenyl)- | 1369259-39-1 | 2A-1198849 |
| 7-Octene-2,4-diyne-1,6-diol,1-(3-heptyl-2-oxiranyl)-, 1-acetate | 145400-15-3 | 2A-1198899 |
| 2,4-Difluoro-3-iodoaniline | 1437316-91-0 | 2A-1198987 |
| disodium 4-[[2,4-dihydroxy-3-[(4-sulphonatophenyl)azo]phenyl]azo]naphthalene-1-sulphonate | 5850-15-7 | 2A-1199036 |
| 2,4-dibromo-3-hydroxybenzoic acid | 91659-00-6 | 2A-1199350 |
| 2,4-Dimethoxybenzaldoxime | 318774-34-7 | 2A-2199462 |
| 2,4-Dinitrophenyl butyrate, | 24273-19-6 | 2A-2199464 |
| 5-Bromo-2,4-dimethylpyrimidine | 69696-37-3 | 2A-2199566 |
| 5-AMINO-2,4-DIFLUOROPHENOL | 113512-71-3 | 2A-1199699 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA