
CAS Number1639-66-3
Synonymsdioctyl sodium sulfosuccinate; PenetratingagentT; elfanol883; dioctyl sulfosuccinate sodium salt; bu-cerumen; 1,2-bis-octyloxycarbonyl-ethanesulfonic acid,sodium-salt; solbaleite; monawetmo-84r2w; di-secovtyl naleate; Sodium di-n-octyl sulfosuccinate; monawetmo-70; monawetmo-70rp; di-n-octyl 2-sulfosuccinate sodium salt; Penetrant T; sodium dioctylsulfosuccinate; Rapid Penetrant T; EINECS 216-684-0
Molecular FormulaC20H37NaO7S
Molecular Weight444.55800
Density1.098 g/cm3
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1639-66-3 |
| Catalog No. | 2A-1198898 |
| Chinese Name | 快速渗透剂T |
| Synonyms | dioctyl sodium sulfosuccinate; PenetratingagentT; elfanol883; dioctyl sulfosuccinate sodium salt; bu-cerumen; 1,2-bis-octyloxycarbonyl-ethanesulfonic acid,sodium-salt; solbaleite; monawetmo-84r2w; di-secovtyl naleate; Sodium di-n-octyl sulfosuccinate; monawetmo-70; monawetmo-70rp; di-n-octyl 2-sulfosuccinate sodium salt; Penetrant T; sodium dioctylsulfosuccinate; Rapid Penetrant T; EINECS 216-684-0 |
| Molecular Formula | C20H37NaO7S |
| Molecular Weight | 444.55800 |
| Density | 1.098 g/cm3 |
| Appearance | colorless liquid |
| Storage Condition | room temperature |
| HTC | 2914509090 |
| SMILES | CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C20H38O7S.Na/c1-3-5-7-9-11-13-15-26-19(21)17-18(28(23,24)25)20(22)27-16-14-12-10-8-6-4-2;/h18H,3-17H2,1-2H3,(H,23,24,25);/q;+1/p-1 |
| InChI Key | RCIJACVHOIKRAP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2,5-DIOXAHEXANEDIOIC ACID DIETHYL ESTER | 35466-87-6 | 2A-1198645 |
| Diethanolamine Fusidate | 16391-75-6 | 2A-1198694 |
| Hexane, Mixture Of Isomers | 92112-69-1 | 2A-1198701 |
| Cyclohexane-1,1-dimethanol | 2658-60-8 | 2A-1198754 |
| [2-(hydroxymethyl)oxolan-2-yl]methanol | 13386-57-7 | 2A-1198755 |
| 5-Chloro-3-fluoro-2-iodotoluene | 939990-13-3 | 2A-1199101 |
| Phosphoric acid 1-[bis(2-chloroethoxy)phosphinyl]-1-methylethylbis(2-chloroethyl) ester | 67063-84-7 | 2A-2199121 |
| 4-Bromo-2-fluoro-5-nitrotoluene | 1345471-69-3 | 2A-1199142 |
| 2-Fluoro-4-bromo-6-chlorotoluene | 1806058-46-7 | 2A-2199148 |
| Bis(4-fluorophenyl)(phenyl)methanol | 379-55-5 | 2A-2199295 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA