
CAS Number452-67-5
SynonymsEINECS 207-205-6; MFCD00000347; 2,5-Difluorotoluene; 1,4-Difluoro-2-methylbenzene; 2,5-Difluoro toluene
Molecular FormulaC7H6F2
Molecular Weight128.119
Purity98%
Density1.1±0.1 g/cm3
Boiling Point116.3±0.0 °C at 760 mmHg
Melting Point-35ºC
AppearanceColorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 452-67-5 |
| Catalog No. | 2A-9002007 |
| Chinese Name | 2,5-二氟甲苯 |
| Synonyms | EINECS 207-205-6; MFCD00000347; 2,5-Difluorotoluene; 1,4-Difluoro-2-methylbenzene; 2,5-Difluoro toluene |
| Molecular Formula | C7H6F2 |
| Molecular Weight | 128.119 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 116.3±0.0 °C at 760 mmHg |
| Melting Point | -35ºC |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| Packaging | II |
| HTC | 2903999090 |
| SMILES | Cc1cc(F)ccc1F |
| InChI | InChI=1S/C7H6F2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| InChI Key | YSNVKDGEALPJGC-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/2007_1_452_67_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 2,5-Difluorotoluene Modification number: 5 Module 14. Shipping information Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: II |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2,2-Diethoxyethanol | 621-63-6 | 2A-9001548 |
| 2,2-Difluoroethanol | 359-13-7 | 2A-9001559 |
| 2,3,4,5-Tetramethoxytoluene | 35896-58-3 | 2A-9001589 |
| 2,3-Diaminotoluene | 2687-25-4 | 2A-9001650 |
| 2,3-Difluorotoluene | 3828-49-7 | 2A-9001705 |
| 2,5-Dimethoxy-4-iodotoluene | 75056-76-7 | 2A-9002012 |
| 2,6-Diaminotoluene | 823-40-5 | 2A-0201423 |
| 2,6-Diaminotoluene-4-sulfonic acid | 98-25-9 | 2A-9002044 |
| 2,6-Difluorotoluene | 443-84-5 | 2A-9002126 |
| 2,6-Dihydroxytoluene | 608-25-3 | 2A-9002132 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA