
CAS Number2015-56-7
SynonymsDiphenyl amidophosphate; aminodiphenoxyphosphino-1-one; DIPHENYL PHOSPHORAMIDATE; O,O-Diphenyl-N,N-dichloramidophosphat; diphenylphosphoroamidate; diphenoxyphosphinic amide; EINECS 217-945-1; DIPHENYL PHOSPHOROAMIDATE; PHOSPHORAMIDIC ACID,DIPHENYL ESTER; MFCD00014078
Molecular FormulaC12H12O3N1P1
Molecular Weight249.21
Density1.29g/cm3
Boiling Point368.2ºC at 760mmHg
Melting Point147-149ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2015-56-7 |
| Catalog No. | 2A-2198686 |
| Chinese Name | 氨基磷酸二苯酯 |
| Synonyms | Diphenyl amidophosphate; aminodiphenoxyphosphino-1-one; DIPHENYL PHOSPHORAMIDATE; O,O-Diphenyl-N,N-dichloramidophosphat; diphenylphosphoroamidate; diphenoxyphosphinic amide; EINECS 217-945-1; DIPHENYL PHOSPHOROAMIDATE; PHOSPHORAMIDIC ACID,DIPHENYL ESTER; MFCD00014078 |
| Molecular Formula | C12H12O3N1P1 |
| Molecular Weight | 249.21 |
| Density | 1.29g/cm3 |
| Boiling Point | 368.2ºC at 760mmHg |
| Melting Point | 147-149ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2929909090 |
| MDL Number | MFCD00014078 |
| SMILES | NP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H12NO3P/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H2,13,14) |
| InChI Key | QWMUDOFWQWBHFI-UHFFFAOYSA-N |
| MSDS | msds/200621_1_2015_56_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Nitroso-N-(methyl-D3)-4-aminobutyric Acid | 1184996-41-5 | 2A-1198674 |
| 3,3-dimethoxycyclobutanecarboxamide | 2360931-42-4 | 2A-1198675 |
| 4-[4-(4-aminophenyl)piperazin-1-yl]aniline | 7479-12-1 | 2A-1198676 |
| TRISTEARIN | 68334-00-9 | 2A-1198682 |
| 1-(3-aMinophenyl)-N-(2-(diMethylaMino)ethyl)MethanesulfonaMide | 1094797-87-1 | 2A-1198684 |
| 4-Chloro-o-aminophenol | 2A-2198687 | 2A-2198687 |
| Isooctanoyl chloride | 70767-37-2 | 2A-1198689 |
| HYDRAZINE CARBONATE | 112077-84-6 | 2A-1198690 |
| Sulopenem Etzadroxil | 1000296-70-7 | 2A-1198691 |
| N,N'-DIACETYLSULFANILAMIDE | 5626-90-4 | 2A-1198693 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA