
CAS Number354-32-5
SynonymsTrifluor-acetylchlorid; trifluoroacetylchloride; MFCD00039307; trifluoroacetic acid chloride; ACETYL CHLORIDE,TRIFLUORO; 2-(trifluoroacetamido)benzoic acid; Trifluoroacetyl chloride; UN3057; 2,2,2-trifluoroacetyl chloride; EINECS 206-556-2; UNII-A23U71SY9G; perfluoroacetyl chloride
Molecular FormulaC2ClF3O
Molecular Weight229.58
Density1.5±0.1 g/cm3
Boiling Point-19.6±35.0 °C at 760 mmHg
Melting Point−146 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 354-32-5 |
| Catalog No. | 2A-1198664 |
| Chinese Name | 三氟乙酰氯 |
| Synonyms | Trifluor-acetylchlorid; trifluoroacetylchloride; MFCD00039307; trifluoroacetic acid chloride; ACETYL CHLORIDE,TRIFLUORO; 2-(trifluoroacetamido)benzoic acid; Trifluoroacetyl chloride; UN3057; 2,2,2-trifluoroacetyl chloride; EINECS 206-556-2; UNII-A23U71SY9G; perfluoroacetyl chloride |
| Molecular Formula | C2ClF3O |
| Molecular Weight | 229.58 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | -19.6±35.0 °C at 760 mmHg |
| Melting Point | −146 °C(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2915900090 |
| PubChem ID | 24854932 |
| MDL Number | MFCD00010418 |
| SMILES | FC(F)(F)C(=O)N1CCC[C@H]1C(Cl)=O |
| InChI | 1S/C7H7ClF3NO2/c8-5(13)4-2-1-3-12(4)6(14)7(9,10)11/h4H,1-3H2/t4-/m0/s1 |
| InChI Key | NUOYJPPISCCYDH-BYPYZUCNSA-N |
| Beilstein/REAXYS | 480791 |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| Hazard Symbols | 2.3 |
| MSDS | msds/200597_1_354_32_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-2,3-dimethylbutyramide | 40963-53-3 | 2A-2198660 |
| sodium fluoride hydrofluoride | 51273-71-3 | 2A-2198661 |
| 7β-Acetyloxy-7α-[9-(dimethyl(tert-butylsilyloxy)nonyl]estr-4-en-3-one | 875573-60-7 | 2A-1198660 |
| Butanamide, 2-amino-3,3-dimethyl | 113582-42-6 | 2A-2198662 |
| 2,2'-Oxybis(N,N-dioctylacetamide) | 342794-43-8 | 2A-2198663 |
| 1-(4-BROMO-PHENYL)-PIPERAZIN-2-ONE | 877679-22-6 | 2A-1198653 |
| 3-Hydroxy Medetomidine | 128366-50-7 | 2A-1198668 |
| SPIRAMYCIN III | 24916-52-7 | 2A-1198669 |
| 2,2'-Bis[4-(3-aminophenoxy)pheny]propane(3-BAPP) | 87880-61-3 | 2A-2198671 |
| (S,S)-(-)-2,3-DIHYDROXY-N,N,N',N'-TETRAMETHYLSUCCINAMIDE | 63126-52-3 | 2A-1198672 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA