
CAS Number6538-82-5
SynonymsCrotonbetain-chlorid; Apocarnitin-hydrochlorid; Crotonobetaine hydrochloride; 2-Propen-1-aminium,3-carboxy-N,N,N-trimethyl-,chloride; Crotonsaeurebetain-chlorid; 3-Carboxy-N,N,N-Trimethyl-2-Propen-1-Aminium Chloride
Molecular FormulaC7H14ClNO2
Molecular Weight179.64
Melting Point>197 °C (dec.)lit.)
AppearanceWhite to off-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6538-82-5 |
| Catalog No. | 2A-1198371 |
| Chinese Name | 3-羧基-N,N,N-三甲基-2-丙烯-1-氯化铵 |
| Synonyms | Crotonbetain-chlorid; Apocarnitin-hydrochlorid; Crotonobetaine hydrochloride; 2-Propen-1-aminium,3-carboxy-N,N,N-trimethyl-,chloride; Crotonsaeurebetain-chlorid; 3-Carboxy-N,N,N-Trimethyl-2-Propen-1-Aminium Chloride |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.64 |
| Melting Point | >197 °C (dec.)lit.) |
| Appearance | White to off-white solid |
| Storage Condition | 20°C, inert gas |
| HTC | 2923900090 |
| SMILES | [Cl-].[N+](C\C=C\C(=O)O)(C)(C)C |
| InChI | 1S/C7H13NO2.ClH/c1-8(2,3)6-4-5-7(9)10;/h4-5H,6H2,1-3H3;1H/b5-4+; |
| InChI Key | PUKNFWRLBQXPFL-FXRZFVDSSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/200264_1_6538_82_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product Name: Summary 2923900090 other quaternary ammonium salts and hydroxides. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Analytical Standards | ||
|---|---|---|
| Tolvaptan Impurity 7 | 1580889-33-3 | 2A-1198146 |
| Tolvaptan Impurity 9 | 1580889-25-3 | 2A-1198147 |
| Tolvaptan Impurity 6 | 1432725-24-0 | 2A-1198149 |
| Tolvaptan Impurity 7 | 1432725-23-9 | 2A-1198160 |
| Pirfenidone Impurity 3 | 2251047-36-4 | 2A-1198227 |
| Levocarnitine iMpurity | 6490-20-6 | 2A-1198372 |
| Methylprednisolone EP Impurity E | 229019-44-7 | 2A-1198442 |
| Pralatrexate Impurity 9 | 1548618-61-6 | 2A-1198443 |
| Fluvoxamine EP Impurity B Maleate | 89035-92-7 | 2A-1198462 |
| Clavulanic acid Impurity 1 | 2196185-67-6 | 2A-1198510 |
| Browse all Analytical Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA