
CAS Number63477-43-0
Synonyms1-chloro-2-hydroxy-3-diphenylmethylaminopropane; 3-chloro-1-diphenylmethylamino-2-hydroxypropane; 2-Propanol,1-chloro-3-[(diphenylmethyl)amino]
Molecular FormulaC16H18ClNO
Molecular Weight224.80
Density1.162 g/cm3(Predicted)
Boiling Point431.5±45.0 °C(Predicted)
Melting Point201 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63477-43-0 |
| Catalog No. | 2A-2198112 |
| Chinese Name | 1-(二苯甲基氨基)-3-氯丙烷-2-醇 |
| Synonyms | 1-chloro-2-hydroxy-3-diphenylmethylaminopropane; 3-chloro-1-diphenylmethylamino-2-hydroxypropane; 2-Propanol,1-chloro-3-[(diphenylmethyl)amino] |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 224.80 |
| Density | 1.162 g/cm3(Predicted) |
| Boiling Point | 431.5±45.0 °C(Predicted) |
| Melting Point | 201 °C |
| Appearance | solid |
| Storage Condition | 2-8°C |
| HTC | 2922199090 |
| MDL Number | MFCD29920232 |
| SMILES | [Si](OCC(O)CCl)(C(C)(C)C)(C)C |
| InChI Key | YBYOMEPBOMOSIB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/199993_1_63477_43_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-amino-8-nitro-2-phenyl-4H-chromen-4-one | 1548405-77-1 | 2A-2198095 |
| 2-(((1H-imidazol-4-yl)methyl)(4-methoxybenzyl)amino)propyl methanesulfonate | 1881288-55-6 | 2A-2198105 |
| 3-propylbenzenamine | 2524-81-4 | 2A-2198106 |
| methyl 5-(aminomethyl)-2-chlorobenzoate hydrochloride | 90942-47-5 | 2A-2198108 |
| methyl 9-oxo-9-phenylnonanoate | 74412-99-0 | 2A-2198111 |
| methyl 3-((3-methoxy-3-oxopropyl)(4-methoxybenzyl)amino)-3-oxopropanoate | 712353-74-7 | 2A-2198113 |
| dimethyl 3,3'-((4-methoxybenzyl)azanediyl)dipropanoate | 1189373-23-6 | 2A-2198114 |
| methyl 3-((4-methoxybenzyl)amino)propanoate | 55383-92-1 | 2A-2198115 |
| 2-(3,4-dihydroxyphenyl)-2,3-dihydroquinolin-4(1H)-one | 2101206-25-9 | 2A-2198116 |
| 2-(5-chloro-2-((4-methoxybenzyl)oxy)phenyl)acetic acid | 2367002-58-0 | 2A-2198117 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA