
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57965-21-6 |
| Catalog No. | 2A-2198050 |
| Chinese Name | 4,4,4-三氟-1-(3-甲氧苯基)丁烷-1,3-二酮 |
| Synonyms | 4,4,4-Trifluoro-1-(3-methoxyphenyl)butane-1,3-dione; 4,4,4-Trifluoro-1-(3-methoxyphenyl)-1,3-butanedione |
| Molecular Formula | C11H9O3F3 |
| Molecular Weight | 246.19 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 283.8±35.0 °C at 760 mmHg |
| Melting Point | 32-34 °C |
| Storage Condition | 2-8°C, inert atmosphere |
| HTC | 2914700090 |
| MDL Number | MFCD03419769 |
| SMILES | COc1cccc(C(=O)CC(=O)C(F)(F)F)c1 |
| InChI Key | DIZYLXQPKFYSGQ-UHFFFAOYSA-N |
| MSDS | msds/199922_1_57965_21_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-fluorotetrahydro-2H-pyran-4-yl methanesulfonate | 1481690-52-1 | 2A-2198042 |
| bis(2,5-dioxopyrrolidin-1-yl) 4-(azidomethyl)heptanedioate | 2173992-21-5 | 2A-2198043 |
| (E)-3-(3,4-dihydroxyphenyl)-1-(2-hydroxy-4,5-dimethylphenyl)prop-2-en-1-one | 1353223-54-7 | 2A-2198047 |
| 2,3-DIFLUORO-5-NITROPHENOL | 1119455-04-7 | 2A-2198048 |
| 1-(2-hydroxy-5-propylphenyl)ethanone | 1990-24-5 | 2A-2198049 |
| ethyl 2-(benzyloxyamino)acetate | 70771-89-0 | 2A-2198051 |
| 2,6-BIS(4-AZIDOBENZYLIDENE)CYCLOHEXANONE | 20237-98-3 | 2A-1198053 |
| N-(6-bromonaphthalen-2-yl)methanesulfonamide | 1132940-86-3 | 2A-2198058 |
| N-(4-acetyl-5-hydroxy-2-nitrophenyl)acetamide | 6607-96-1 | 2A-2198065 |
| N-(4-acetyl-3-hydroxy-2-nitrophenyl)acetamide | 30192-48-4 | 2A-2198066 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA