CAS Number3771-13-9
Synonyms3-bromomethyl-4-chloro-anisole; 3-Brommethyl-4-chlor-anisol; 2-bromomethyl-1-chloro-4-methoxybenzene; 2-chloro-5-methoxy-benzyl bromide; 2-(Bromomethyl)-1-chloro-4-methoxybenzene
Molecular FormulaC8H8O1Cl1Br1
Molecular Weight235.51
Density1.5±0.1 g/cm3
Boiling Point275.1±25.0 °C at 760 mmHg
Melting Point57-58 °C
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3771-13-9 |
| Catalog No. | 2A-1197590 |
| Chinese Name | 2-溴甲基-1-氯-4-甲氧基-苯 |
| Synonyms | 3-bromomethyl-4-chloro-anisole; 3-Brommethyl-4-chlor-anisol; 2-bromomethyl-1-chloro-4-methoxybenzene; 2-chloro-5-methoxy-benzyl bromide; 2-(Bromomethyl)-1-chloro-4-methoxybenzene |
| Molecular Formula | C8H8O1Cl1Br1 |
| Molecular Weight | 235.51 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 275.1±25.0 °C at 760 mmHg |
| Melting Point | 57-58 °C |
| Appearance | White to yellow solid |
| Storage Condition | 2-8°C, dry, sealed |
| HTC | 2909309090 |
| PubChem ID | 38641075 |
| MDL Number | MFCD12024392 |
| SMILES | COc1ccc(Cl)c(CBr)c1 |
| InChI | InChI=1S/C8H8BrClO/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,5H2,1H3 |
| InChI Key | GHKLXXBWQJOXKB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1,1'-Bicyclohexyl, 4-(chloromethyl)-4'-propyl- | 1384466-01-6 | 2A-1197320 |
| [1,1'-Biphenyl]-4-ethanol, α-(chloromethyl)-, (αS)- | 1573000-28-8 | 2A-1197387 |
| Methyl 2,6-dimethyl-4-oxocyclohex-2-enecarboxylate | 67333-67-9 | 2A-1197435 |
| Dichlorobenzaldehyde | 31155-09-6 | 2A-2197448 |
| 1,1-DICHLORO-2,2,2-TRIFLUOROETHYL DIFLUOROMETHYL ETHER | 32778-07-7 | 2A-1197480 |
| 4-(BROMOMETHYL)-3-NITROBENZOIC ACID | 20782-91-6 | 2A-1197609 |
| PINACOLONE OXIME | 2475-93-6 | 2A-1197611 |
| 4'-N-DECYLOXYBIPHENYL-4-CARBOXYLIC ACID | 69367-32-4 | 2A-1197629 |
| 4'-ACETOXY-BIPHENYL-4-CARBOXYLIC ACID | 75175-09-6 | 2A-1197630 |
| 2-(bromomethyl)-1-chloro-3-methoxybenzene | 83781-95-7 | 2A-1197634 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS