
CAS Number2409-52-1
Synonymsdiethylitaconate; Butanedioic acid,methylene-,diethyl ester; Ethyl itaconate; Itaconic Acid Diethyl Ester; Diethyl 2-methylenesuccinate; diethyl methylidenesuccinate; 2-methylene succinic acid diethyl ester; methylene-succinic acid diethyl ester; diethyl ester of itaconic acid
Molecular FormulaC9H14O4
Molecular Weight186.21
Density1.04g/cm3
Boiling Point228ºC at 760mmHg
AppearanceColorless - very light yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2409-52-1 |
| Catalog No. | 2A-1197562 |
| Chinese Name | 衣康酸二乙酯 |
| Synonyms | diethylitaconate; Butanedioic acid,methylene-,diethyl ester; Ethyl itaconate; Itaconic Acid Diethyl Ester; Diethyl 2-methylenesuccinate; diethyl methylidenesuccinate; 2-methylene succinic acid diethyl ester; methylene-succinic acid diethyl ester; diethyl ester of itaconic acid |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| Density | 1.04g/cm3 |
| Boiling Point | 228ºC at 760mmHg |
| Appearance | Colorless - very light yellow transparent liquid |
| Storage Condition | room temperature, dry |
| HTC | 2917190090 |
| PubChem ID | 68556 |
| MDL Number | MFCD00059230 |
| SMILES | C=C(CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C9H14O4/c1-4-12-8(10)6-7(3)9(11)13-5-2/h3-6H2,1-2H3 |
| InChI Key | ZEFVHSWKYCYFFL-UHFFFAOYSA-N |
| MSDS | msds/199405_1_2409_52_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| GALLIUM ACETATE | 2571-06-4 | 2A-2197558 |
| INDIUM(III) ACETATE HYDRATE | 304671-64-5 | 2A-2197559 |
| CHROMIUM BROMIDE | 10031-25-1 | 2A-2197560 |
| Germanium(II) iodide | 13573-08-5 | 2A-2197561 |
| N-Benzyl Medetomidine | 2250242-52-3 | 2A-1197553 |
| methyl 6-chlorohexanoate | 14273-89-3 | 2A-1197563 |
| ethyl 6-chlorohexanoate | 10140-96-2 | 2A-1197564 |
| 1,4-DIACETOXYBUTANE | 628-67-1 | 2A-1197565 |
| n-Propyl ether | 111-43-3 | 2A-1197566 |
| 1,4-DIBUTOXYBENZENE | 104-36-9 | 2A-1197567 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA