
CAS Number17626-02-7
Synonyms2,5-dimethoxy-1,4-phenylenediamine; 2,5-dimethoxy-p-phenylenediamine; 2,5-dimethoxy-1,4-diaminobenzene; 2,5-diamino-1,4-dimethoxybenzene; 1,4-diamino-2,5-dimethoxybenzene; 4-Amino-2,5-dimethoxyaniline; 1,4-dimethoxyphenylene-2,5-diamine; 2,5-Dimethoxy-1,4-benzenediamine; 1,4-diamino-3,6-dimethoxybenzene
Molecular FormulaC8H12N2O2
Molecular Weight168.19300
Density1.184g/cm3
Boiling Point337.9ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17626-02-7 |
| Catalog No. | 2A-1196963 |
| Chinese Name | 2,5-二甲氧基对苯二胺 |
| Synonyms | 2,5-dimethoxy-1,4-phenylenediamine; 2,5-dimethoxy-p-phenylenediamine; 2,5-dimethoxy-1,4-diaminobenzene; 2,5-diamino-1,4-dimethoxybenzene; 1,4-diamino-2,5-dimethoxybenzene; 4-Amino-2,5-dimethoxyaniline; 1,4-dimethoxyphenylene-2,5-diamine; 2,5-Dimethoxy-1,4-benzenediamine; 1,4-diamino-3,6-dimethoxybenzene |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19300 |
| Density | 1.184g/cm3 |
| Boiling Point | 337.9ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 3225614 |
| SMILES | COc1cc(N)c(OC)cc1N |
| InChI | InChI=1S/C8H12N2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,9-10H2,1-2H3 |
| InChI Key | FOVOBTLEKSQTFG-UHFFFAOYSA-N |
| MSDS | msds/198766_1_17626_02_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(piperidin-4-yl)quinolin-2(1h)-one hydrochloride | 855778-84-6 | 2A-2196956 |
| 2-Aminophenol-4-sulfonanilide | 23306-60-7 | 2A-1196958 |
| 1,3-Naphthalenedisulfonicacid, 7-[[(3-aminophenyl)sulfonyl]amino]- | 143683-20-9 | 2A-1196960 |
| 1-(3'-SULFOPHENYL)-3-METHYL-5-AMINOPYRAZOL | 23646-86-8 | 2A-1196961 |
| 2-methoxybenzene-1,4-diammonium sulphate | 42909-29-5 | 2A-1196962 |
| BMS-986165 | 1802425-99-5 | 2A-2196964 |
| 2-Chloro-N-(cyano-2-thienylMethyl)acetaMide | 263137-41-3 | 2A-1196965 |
| Clodronic Acid Monoisopropyl Ester | 134757-52-1 | 2A-1196967 |
| Tetramethylammonium bicarbonate | 58345-96-3 | 2A-1196968 |
| 1-(4-Bromo-3-nitrophenyl)butan-1-one | 91715-78-5 | 2A-2196970 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA