
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 777-54-8 |
| Catalog No. | 2A-1196919 |
| Chinese Name | 2-(4-氯-3-甲基苯氧基)丙酸 |
| Synonyms | 4-Chlor-3-methylphenoxy-propionsaeure |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 228.67 |
| Density | 1.265g/cm3 |
| Boiling Point | 338.8ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329782067 |
| MDL Number | MFCD01697494 |
| SMILES | Cc1cc(OC(C)(C)C(O)=O)ccc1Cl |
| InChI | 1S/C11H13ClO3/c1-7-6-8(4-5-9(7)12)15-11(2,3)10(13)14/h4-6H,1-3H3,(H,13,14) |
| InChI Key | YPACJSWITQPMFV-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/198720_1_777_54_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-BENZYLOXY-3-METHOXY-BENZONITRILE | 52805-34-2 | 2A-2196910 |
| 5-Bromo-2-ethyl-phenylamine | 14922-91-9 | 2A-2196912 |
| DIALLYLAMINE HYDROCHLORIDE | 6147-66-6 | 2A-2196913 |
| 2-Benzyloxy-3-dibenzylaMino-5-fluoro-6-Methyl-benzoic acid phenyl ester | 1253799-29-9 | 2A-1196914 |
| 3-(2-Methylphenyl)-2-((Z)-propylimino)thiazolidin-4-one | 854107-53-2 | 2A-1196916 |
| 3-Pyrrolidinone, 4-(3-chloropropyl)-1-(phenylmethyl)-, hydrochloride | 1430075-00-5 | 2A-1196923 |
| 2-acetaMidonon-8-enoic acid | 924309-93-3 | 2A-1196924 |
| 6-chloro-5-(2-methyl-2H-tetrazol-5-yl)pyrimidin-4-amine | 1682607-95-9 | 2A-1196928 |
| methyl 3-amino-3-(4-(ethylsulfonyl)phenyl)propanoate | 2231669-23-9 | 2A-1196933 |
| Benzeneacetic acid, α-amino-4-(ethylsulfonyl)-, methyl ester | 1888617-02-4 | 2A-1196936 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA