
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83968-49-4 |
| Catalog No. | 2A-2196879 |
| Chinese Name | 赖氨加压素醋酸盐 |
| Synonyms | MFCD00133970 |
| Molecular Formula | C48H69N13O14S2 |
| Molecular Weight | 1227.37 (free base basis) |
| Purity | ≥95 (HPLC) |
| Appearance | lyophilized powder |
| Storage Condition | -20°C, protected from light |
| Application | Lysinopressin (acetate) is an antidiuretic hormone that has been found in pigs and some marsupial families. Induces rabbit bladder smooth muscle contraction and activates adenylyl cyclase[1][2]. |
| PubChem ID | 135288022 |
| SMILES | S1SC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C1)C(=O)N4[C@@H](CCC4)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N)Cc3ccccc3)Cc2ccc(cc2)O)NC(=O)CNC(=O)CNC(=O)CN.OC(=O)C.OC(=O)C |
| InChI | 1S/C52H74N16O15S2.2C2H4O2/c53-17-5-4-9-31(45(76)60-23-41(57)72)63-51(82)38-10-6-18-68(38)52(83)37-27-85-84-26-36(61-44(75)25-59-43(74)24-58-42(73)22-54)50(81)65-34(20-29-11-13-30(69)14-12-29)48(79)64-33(19-28-7-2-1-3-8-28)47(78)62-32(15-16-39(55)70)46(77)66-35(21-40(56)71)49(80)67-37;2*1-2(3)4/h1-3,7-8,11-14,31-38,69H,4-6,9-10,15-27,53-54H2,(H2,55,70)(H2,56,71)(H2,57,72)(H,58,73)(H,59,74)(H,60,76)(H,61,75)(H,62,78)(H,63,82)(H,64,79)(H,65,81)(H,66,77)(H,67,80);2*1H3,(H,3,4)/t31-,32-,33-,34-,35-,36-,37-,38-;;/m0../s1 |
| InChI Key | WNFVFDPQEHRNTC-LWCZBKQBSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/198675_1_83968_49_4.pdf |
| Transport Info | Product name: [Lys8]-Vasopressin acetate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Atrial Natriuretic Peptide (ANP) (1-28), human, porcine (Acetate) | 1366000-58-9 | 2A-2196874 |
| ANP 1-28, HUMAN | 91917-63-4 | 2A-2196875 |
| LL-37 | 154947-66-7 | 2A-2196876 |
| afamelanotide | 1566590-77-9 | 2A-2196877 |
| ASP-ARG-VAL-TYR-ILE-HIS-PRO-PHE ACETATE SALT | 68521-88-0 | 2A-2196878 |
| Butanoic acid, 4-[2-hydroxy-1-(hydroxymethyl)ethoxy]-, methyl ester | 820247-03-8 | 2A-2196883 |
| Benzeneacetic acid, 3-fluoro-α-hydroxy-, (αR)- | 32222-47-2 | 2A-2196886 |
| ISOAMYL NITRITE-15N | 120670-20-4 | 2A-4196889 |
| GLY-GLY-TYR-ARG | 70195-20-9 | 2A-2196890 |
| Bivalirudin | 1191386-55-6 | 2A-2196892 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA