
CAS Number51963-82-7
Synonyms2,5-Diethoxy-4-morpholinyl aniline; 2,4-DIFLUORO-5-NITROACETANILIDE; EINECS 257-562-7; MFCD02052680; 2,5-Diethoxy-4-morpholinoaniline
Molecular FormulaC14H20N2O5
Molecular Weight296.326
Purity98%
Density1.128 g/cm3
Boiling Point466ºC at 760 mmHg
Melting Point83-86ºC
AppearanceLight gray to beige crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51963-82-7 |
| Catalog No. | 2A-9001982 |
| Chinese Name | 2,5-二乙氧基-4-吗啉基苯胺 |
| Synonyms | 2,5-Diethoxy-4-morpholinyl aniline; 2,4-DIFLUORO-5-NITROACETANILIDE; EINECS 257-562-7; MFCD02052680; 2,5-Diethoxy-4-morpholinoaniline |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.326 |
| Purity | 98 |
| Density | 1.128 g/cm3 |
| Boiling Point | 466ºC at 760 mmHg |
| Melting Point | 83-86ºC |
| Appearance | Light gray to beige crystalline powder |
| HTC | 2934999090 |
| MDL Number | MFCD00023311 |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1N |
| InChI | InChI=1S/C14H22N2O3/c1-3-18-13-10-12(16-5-7-17-8-6-16)14(19-4-2)9-11(13)15/h9-10H,3-8,15H2,1-2H3 |
| InChI Key | DDCBPJKVWMBNCC-UHFFFAOYSA-N |
| MSDS | msds/1982_1_51963_82_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dichlorobenzoyl chloride | 2905-61-5 | 2A-9001974 |
| 2,5-Dichlorofluorobenzene | 348-59-4 | 2A-9001975 |
| 2,5-Dichloronicotinic acid | 59782-85-3 | 2A-9001976 |
| 2,5-Dichlorothiophenol | 5858-18-4 | 2A-9001980 |
| 2,5-Diethoxy-4-((4-methylphenyl)thio)aniline | 68400-48-6 | 2A-9001981 |
| 2,5-Diethoxythiophenol | 29236-93-9 | 2A-9001983 |
| 2',5'-Difluoroacetophenone | 1979-36-8 | 2A-9001984 |
| 2,5-Difluoroaniline | 367-30-6 | 2A-9001985 |
| 2,5-Difluoroanisole | 75626-17-4 | 2A-9001986 |
| 2,5-Difluorobenzamide | 85118-03-2 | 2A-9001988 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA