
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104226-19-9 |
| Catalog No. | 2A-2196424 |
| Chinese Name | HC 紫 NO. 2 |
| Synonyms | HC Violet 2; HC Violet no. 2; UNII-639H4QR04O; Imexine Fag |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.32300 |
| Purity | 99.9 |
| Appearance | solid |
| HTC | 2922199090 |
| PubChem ID | 38329653 |
| SMILES | [H+].[I-][Pb+2]([I-])[I-].N=CN |
| InChI | InChI=1S/CH4N2.3HI.Pb/c2-1-3;;;;/h1H,(H3,2,3);3*1H;/q;;;;+2/p-2 |
| InChI Key | YHSOWKGIYXECIF-UHFFFAOYSA-N |
| MSDS | msds/198193_1_104226_19_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 4-(benzyloxy)-3-oxobutanoate | 67354-34-1 | 2A-1196422 |
| MALONANILIDE | 621-10-3 | 2A-2196423 |
| 4-(3-METHOXY-PHENYL)-3-OXO-BUTYRIC ACID ETHYL ESTER | 324570-26-5 | 2A-1196424 |
| S-BENZYL-L-CYSTEINOL | 85803-43-6 | 2A-1196427 |
| N-PROPARGYLPHTHALIMIDE | 7223-50-9 | 2A-1196428 |
| HC yellow no2 | 94158-13-1 | 2A-2196429 |
| (2-OXO-2-PHENYL-ETHYL)-CARBAMIC ACID TERT-BUTYL ESTER | 114744-83-1 | 2A-1196432 |
| BENZYL (2-OXO-2-PHENYLETHYL)CARBAMATE | 146553-06-2 | 2A-1196435 |
| Cyclobutanecarboxamide, N-methoxy-N-methyl- (9CI) | 640768-72-5 | 2A-1196438 |
| Cyclopentanecarboxamide, N-methoxy-N-methyl- (9CI) | 167303-65-3 | 2A-1196439 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA