![Benzaldehyde, 4,4',4''-[1,3,5-triazine-2,4,6-triyltris(oxy)]tris- structure, CAS 3140-75-8](/structures/210000/198098_1_3140_75_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3140-75-8 |
| Catalog No. | 2A-1196341 |
| Chinese Name | 2,4,6-三(4-甲酰基苯氧基)-1,3,5-三嗪 |
| Molecular Formula | C24H15O6N3 |
| Molecular Weight | 441.4 |
| Melting Point | 181 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2933699090 |
| PubChem ID | 16850678 |
| MDL Number | MFCD31700811 |
| SMILES | O=Cc1ccc(Oc2nc(Oc3ccc(C=O)cc3)nc(Oc3ccc(C=O)cc3)n2)cc1 |
| InChI | InChI=1S/C24H15N3O6/c28-13-16-1-7-19(8-2-16)31-22-25-23(32-20-9-3-17(14-29)4-10-20)27-24(26-22)33-21-11-5-18(15-30)6-12-21/h1-15H |
| InChI Key | YNLBSRHGIHAPAE-UHFFFAOYSA-N |
| MSDS | msds/198098_1_3140_75_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1,7-dihydrodibenzo[b,e][1,4]dioxino[2,3-d:7,8-d']bis([1,2,3]triazole) | 1276042-43-3 | 2A-1196321 |
| 4,7-dibromo-1H-benzo[d]imidazole | 148185-66-4 | 2A-1196328 |
| 2H-Tetrazole, 5-[4-(1H-1,2,4-triazol-1-yl)phenyl]- | 1423810-54-1 | 2A-1196332 |
| 2,4,6-TRIS(4-CARBOXYPHENYL)-1,3,5-TRIAZINE | 61414-16-2 | 2A-1196334 |
| 5,5-difluoro-2,8-diformyl-1,3,7,9-tetramethyl-10-phenyl-5H-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-4-ium-5-uide | 2022166-57-8 | 2A-1196335 |
| 6-Hydroxy-4-quinolinecarboxylic acid | 4312-44-1 | 2A-1196344 |
| Piperidine, 3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-methyl-, cis-(+)- (9CI | 112058-87-4 | 2A-1196347 |
| 7,7-dimethyl-7H-fluoreno[4,3-b]benzofuran | 1374677-48-1 | 2A-1196350 |
| 2-chlorodibenzo[f,h]quinazoline | 1632350-82-3 | 2A-1196351 |
| 2-chloro-4-phenylbenzo[h]quinazoline | 4786-80-5 | 2A-1196352 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA