
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52710-27-7 |
| Catalog No. | 2A-1196292 |
| Chinese Name | 4-丙基苯甲酰氯 |
| Synonyms | 4-Propylbenzoyl chloride; MFCD00000698 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.64700 |
| Density | 1.097 g/mL at 25 °C(lit.) |
| Boiling Point | 135-136 °C20 mm Hg(lit.) |
| Appearance | Colorless-gray scented liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 2916399090 |
| PubChem ID | 3157238 |
| SMILES | CCCc1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C10H11ClO/c1-2-3-8-4-6-9(7-5-8)10(11)12/h4-7H,2-3H2,1H3 |
| InChI Key | NZYPCJXREKMMCJ-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzene, 1-(4'-ethenyl[1,1'-bicyclohexyl]-4-yl)-4-methyl- | 1184918-80-6 | 2A-1196282 |
| 1,1'-Biphenyl, 4-ethoxy-2,3-difluoro-4'-methyl- | 475644-24-7 | 2A-1196283 |
| 1,1'-Biphenyl, 4-(3-buten-1-yl)-4'-methyl- | 117713-14-1 | 2A-1196284 |
| trans-4-(trans-4-Ethylcyclohexyl)cyclohexyl]methyl methanesulfonate | 819862-02-7 | 2A-1196286 |
| Benzoyl chloride, 4-(trans-4-propylcyclohexyl)- | 81005-00-7 | 2A-1196291 |
| 4-N-BUTYLBENZOYL CHLORIDE | 28788-62-7 | 2A-1196293 |
| 4-PENTYLBENZOYL CHLORIDE | 49763-65-7 | 2A-1196294 |
| Cefoperazone dihydrate | 113826-44-1 | 2A-1196276 |
| NARASIN | 55134-13-9 | 2A-1196297 |
| Cyclohexanone, 3-(6-Methoxy-2-naphthalenyl)-5-Methyl- | 343272-52-6 | 2A-1196299 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA