
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 110114-05-1 |
| Catalog No. | 2A-1196240 |
| Chinese Name | ethyl 3-(3-formylphenyl)propanoate |
| Synonyms | 3-(3-Formylphenyl)propionicacid ethyl ester; Benzenepropanoic acid,3-formyl-,ethyl ester; 3-Formylbenzenepropanoic acid ethyl ester |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| HTC | 2918300090 |
| PubChem ID | 129535849 |
| MDL Number | MFCD08234825 |
| SMILES | CCOC(=O)CCc1cccc(C=O)c1 |
| InChI | InChI=1S/C12H14O3/c1-2-15-12(14)7-6-10-4-3-5-11(8-10)9-13/h3-5,8-9H,2,6-7H2,1H3 |
| InChI Key | VWEFFVXBQNGXTG-UHFFFAOYSA-N |
| MSDS | msds/197987_1_110114_05_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 4-(4-cyanophenyl)butanoate | 131379-33-4 | 2A-1196234 |
| 4-(Aminomethyl)benzenebutanoic acid ethyl ester | 757139-57-4 | 2A-1196235 |
| 2-(3-Azetidinyloxy)acetic acid 1,1-dimethylethyl ester | 1243440-47-2 | 2A-1196237 |
| 3-bromo-2-(methylthio)phenol | 107724-66-3 | 2A-1196238 |
| 4,6-dimethylsalicylic acid | 6370-32-7 | 2A-1196239 |
| 3-BroMo-4-forMylbenzoic acid | 91760-66-6 | 2A-1196241 |
| 4-chloro-2-isopropylphenol | 54461-05-1 | 2A-1196242 |
| 2-chloro-1-iodo-4-methoxybenzene | 219735-98-5 | 2A-1196243 |
| 5-AMINO-2-HYDROXYBENZONITRILE | 67608-58-6 | 2A-1196244 |
| 4-(aminomethyl)-3-methylphenol | 1243347-65-0 | 2A-1196246 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA